|
|
| | N-[3-Fluoro-4-[(methylamino)carbonyl]phenyl]-2-methylalanine methyl ester Basic information |
| Product Name: | N-[3-Fluoro-4-[(methylamino)carbonyl]phenyl]-2-methylalanine methyl ester | | Synonyms: | Alanine, N-[3-fluoro-4-[(MethylaMino)carbonyl]phenyl]-2-Methyl-, Methyl ester;N-[3-fluoro-4-[(MethylaMino)carbonyl]phenyl]-2-Methyl-Alanine Methyl ester 2-(3-Fluoro-4-MethylcarbaMoyl-phenylaMino)-2-Methyl-propionic acid Methyl ester ";N-[3-Fluoro-4-[(methylamino)carbonyl]phenyl]-2-methylalanine methyl ester;NN-[3-Fluoro-4-[(methylamino)carbonyl]phenyl]-2-methylalanine methyl ester;methyl 2-[3-fluoro-4-(methylcarbamoyl)anilino]-2-methyl-propanoat e;Enzalutamide Impurity 32;N-[3-fluoro-4-[(methylamino) carbonyl]benzene Subunit]-2-Methyl alanine;2-{[3-fluoro-4-(methylcarbamoyl)phenyl]amino}-2-methylpropanoate | | CAS: | 1332524-01-2 | | MF: | C13H17FN2O3 | | MW: | 268.28 | | EINECS: | | | Product Categories: | | | Mol File: | 1332524-01-2.mol | ![N-[3-Fluoro-4-[(methylamino)carbonyl]phenyl]-2-methylalanine methyl ester Structure](CAS/20150408/GIF/1332524-01-2.gif) |
| | N-[3-Fluoro-4-[(methylamino)carbonyl]phenyl]-2-methylalanine methyl ester Chemical Properties |
| Boiling point | 381℃ | | density | 1.203 | | Fp | 184℃ | | storage temp. | Storage temp. 2-8°C | | solubility | Chloroform, DCM, Ethyl Acetate | | pka | 14.35±0.46(Predicted) | | form | Solid | | color | White | | InChI | InChI=1S/C13H17FN2O3/c1-13(2,12(18)19-4)16-8-5-6-9(10(14)7-8)11(17)15-3/h5-7,16H,1-4H3,(H,15,17) | | InChIKey | MLHUTKWFDCMHQO-UHFFFAOYSA-N | | SMILES | C(OC)(=O)[C@](C)(C)NC1=CC=C(C(NC)=O)C(F)=C1 |
| | N-[3-Fluoro-4-[(methylamino)carbonyl]phenyl]-2-methylalanine methyl ester Usage And Synthesis |
| Uses | N-[3-Fluoro-4-[(methylamino)carbonyl]phenyl]-2-methylalanine Methyl Ester is an intermediate in the synthesis of MDV 3100 (M199800), is an androgen-receptor antagonist that blocks androgens from binding to the androgen receptor and prevents nuclear translocation and co-activator recruitment of the ligand-receptor complex. |
| | N-[3-Fluoro-4-[(methylamino)carbonyl]phenyl]-2-methylalanine methyl ester Preparation Products And Raw materials |
|