5-broMo-2-(3-(chloroMethyl)phenyl)pyriMidine manufacturers
|
| | 5-broMo-2-(3-(chloroMethyl)phenyl)pyriMidine Basic information |
| | 5-broMo-2-(3-(chloroMethyl)phenyl)pyriMidine Chemical Properties |
| Boiling point | 306.8±34.0 °C(Predicted) | | density | 1.532±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | -0.59±0.42(Predicted) | | Appearance | white solid | | InChI | 1S/C11H8BrClN2/c12-10-6-14-11(15-7-10)9-3-1-2-8(4-9)5-13/h1-4,6-7H,5H2 | | InChIKey | KHSZEUJOVUJWKR-UHFFFAOYSA-N | | SMILES | ClCC1=CC=CC(C2=NC=C(Br)C=N2)=C1 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN2811 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 5-broMo-2-(3-(chloroMethyl)phenyl)pyriMidine Usage And Synthesis |
| | 5-broMo-2-(3-(chloroMethyl)phenyl)pyriMidine Preparation Products And Raw materials |
|