|
|
| | Flurbiprofen IMpurity B Basic information |
| Product Name: | Flurbiprofen IMpurity B | | Synonyms: | Flurbiprofen IMpurity B;FlurBiprofen impurity 3;YVWIRDHPNGRLMV-UHFFFAOYSA-N;2-(2-fluorobiphenyl-4-yl)-2,3-dimethylbutanedioic acid;Flurbiprofen EP Impurity B (Mixture of Diastereomers);Butanedioic acid, 2-(2-fluoro[1,1'-biphenyl]-4-yl)-2,3-dimethyl-;Flurbiprofen Impurity 2(Flurbiprofen EP Impurity B);2-(2-fluoro-[1,1'-biphenyl]-4-yl)-2,3-dimethylsuccinic acid | | CAS: | 1797883-74-9 | | MF: | C18H17FO4 | | MW: | 316.32 | | EINECS: | | | Product Categories: | | | Mol File: | 1797883-74-9.mol |  |
| | Flurbiprofen IMpurity B Chemical Properties |
| Boiling point | 424.6±40.0 °C(Predicted) | | density | 1.274±0.06 g/cm3(Predicted) | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 3.71±0.11(Predicted) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C18H17FO4/c1-11(16(20)21)18(2,17(22)23)13-8-9-14(15(19)10-13)12-6-4-3-5-7-12/h3-11H,1-2H3,(H,20,21)(H,22,23) | | InChIKey | YVWIRDHPNGRLMV-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(C1=CC=C(C2=CC=CC=C2)C(F)=C1)(C)C(C)C(O)=O |
| | Flurbiprofen IMpurity B Usage And Synthesis |
| Uses | 2-(2-Fluoro[1,1''-biphenyl]-4-yl)-2,3-dimethylbutanedioic acid is an impurity of Flurbiprofen (F598700), an anti-inflammatory used as an analgesic. Flurbiprofen impurity B. |
| | Flurbiprofen IMpurity B Preparation Products And Raw materials |
|