CYCLOPENTYLACETIC ACID manufacturers
|
| | CYCLOPENTYLACETIC ACID Basic information | | Uses |
| | CYCLOPENTYLACETIC ACID Chemical Properties |
| Melting point | 12-14°C | | Boiling point | 133-134 °C/23 mmHg (lit.) | | density | 1.022 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.453(lit.) | | Fp | 229 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Chloroform, Methanol | | form | Liquid | | pka | 4.85±0.10(Predicted) | | color | Clear colorless | | BRN | 2040821 | | InChI | InChI=1S/C7H12O2/c8-7(9)5-6-3-1-2-4-6/h6H,1-5H2,(H,8,9) | | InChIKey | YVHAIVPPUIZFBA-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)CCCC1 | | CAS DataBase Reference | 1123-00-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | UN 3334 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29162090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | CYCLOPENTYLACETIC ACID Usage And Synthesis |
| Uses | Cyclopentylacetic acid is a reagent the synthesis of Cyclopentamine, which is a vasoconstrictor that acts as a releasing agent of the neurotransmitters norepinephrine, epinephrine and dopamine. | | Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | Cyclopentylacetic acid has been used in a study to examine the butylation efficiency of free carboxylic acids. | | Definition | ChEBI: Cyclopentylacetic acid is a carboxylic acid. |
| | CYCLOPENTYLACETIC ACID Preparation Products And Raw materials |
|