|
|
| | 2,5-Bis(trifluoromethyl)bromobenzene Basic information |
| Product Name: | 2,5-Bis(trifluoromethyl)bromobenzene | | Synonyms: | 1-BROMO-2,5-BIS(TRIFLUOROMETHYL)BENZENE;1,4-BIS(TRIFLUOROMETHYL)-2-BROMOBENZENE;2,5-BIS(TRIFLUOROMETHYL)BROMOBENZENE;2,5-Bis(Trifluoromethyl) Bromobenzene 2,5-Bis(Trifluoromethyl)Bromobenzene;2-bromo-1,4-bis(trifluoromethyl)benzene;2,5-Bis(trifluoromethyl)bromobenzene,97%;2,5-2,5-bis(trifluoromethyl)bromobenzene;2,5-Ditrifluoromethylbromobenzene | | CAS: | 7617-93-8 | | MF: | C8H3BrF6 | | MW: | 293 | | EINECS: | 676-876-9 | | Product Categories: | Aryl;C8;Aromatic Halides (substituted);Halogenated Hydrocarbons | | Mol File: | 7617-93-8.mol |  |
| | 2,5-Bis(trifluoromethyl)bromobenzene Chemical Properties |
| Melting point | 5 °C | | Boiling point | 146-147 °C(lit.) | | density | 1.691 g/mL at 25 °C(lit.) | | refractive index | n20/D >1.4340(lit.) | | Fp | >230 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | clear liquid | | color | Light yellow to Brown | | Specific Gravity | 1.691 | | InChI | 1S/C8H3BrF6/c9-6-3-4(7(10,11)12)1-2-5(6)8(13,14)15/h1-3H | | InChIKey | GFQNSGHVOFVTLC-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1ccc(c(Br)c1)C(F)(F)F | | CAS DataBase Reference | 7617-93-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29039990 | | Storage Class | 10 - Combustible liquids |
| | 2,5-Bis(trifluoromethyl)bromobenzene Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | General Description | 2,5-Bis(trifluoromethyl)bromobenzene is a halogenated hydrocarbon. |
| | 2,5-Bis(trifluoromethyl)bromobenzene Preparation Products And Raw materials |
|