- COELENTERAZINE 400 A
-
- $1.00
-
2019-07-06
- CAS:70217-82-2
- Min. Order: 1kg
- Purity: 95%-99%
- Supply Ability: 10kg
|
| | COELENTERAZINE 400 A Basic information |
| Product Name: | COELENTERAZINE 400 A | | Synonyms: | COELENTERAZINE 400 A;DI-DEHYDRO COELENTERAZINE;DEEPBLUEC(TM);BlueSyn C;Coelenteramine 400a;2,8-DIBENZYL-6-PHENYL-IMIDAZO[1,2A]PYRAZIN-3-(7H)-ONE;Coelenterazine 400a (Coelenteramine 400a);Imidazo[1,2-a]pyrazin-3(7H)-one, 6-phenyl-2,8-bis(phenylmethyl)- | | CAS: | 70217-82-2 | | MF: | C26H21N3O | | MW: | 391.46 | | EINECS: | | | Product Categories: | | | Mol File: | 70217-82-2.mol |  |
| | COELENTERAZINE 400 A Chemical Properties |
| Boiling point | 551.4±60.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | solubility | Ethanol: 0.5 mg/ml *; Methanol: 0.5 mg/ml * | | form | A crystalline solid | | pka | 6.84±0.40(Predicted) | | color | Brown to dark brown | | Appearance | Solid Powder | | Stability: | Unstable in Solution | | InChI | InChI=1S/C26H21N3O/c30-26-23(17-20-12-6-2-7-13-20)28-25-22(16-19-10-4-1-5-11-19)27-24(18-29(25)26)21-14-8-3-9-15-21/h1-15,18,27H,16-17H2 | | InChIKey | MWOYPGFRXPPBOX-UHFFFAOYSA-N | | SMILES | C12N=C(CC3=CC=CC=C3)C(=O)N1C=C(C1=CC=CC=C1)NC=2CC1=CC=CC=C1 |
| | COELENTERAZINE 400 A Usage And Synthesis |
| Description | Coelenterazine 400a is a derivative of coelenterazine that produces chemiluminescence displayed by the Aequorin protein in the presence of Ca2+. It is used in BRET study as an indicator for intracelluar Ca2+. | | Uses | Coelenterazine 400a is a chromophore that produces the chemiluminescence displayed by the Aequorin protein in the presence of Ca2+. |
| | COELENTERAZINE 400 A Preparation Products And Raw materials |
|