|
|
| | 3-IODO-4-NITROTOLUENE Basic information |
| | 3-IODO-4-NITROTOLUENE Chemical Properties |
| Melting point | 18-20 °C | | Boiling point | 295 °C | | density | 1.862 g/mL at 25 °C | | refractive index | n20/D 1.637 | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Low Melting Crystalline Mass or Liquid | | color | Yellow | | InChI | 1S/C7H6INO2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3 | | InChIKey | DJDSQNLIZRLTHJ-UHFFFAOYSA-N | | SMILES | Cc1ccc(c(I)c1)[N+]([O-])=O |
| Hazard Codes | Xn,N | | Risk Statements | 22-50 | | Safety Statements | 60-61 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 2 | | HS Code | 29049090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 |
| | 3-IODO-4-NITROTOLUENE Usage And Synthesis |
| Chemical Properties | yellow low melting crystalline mass or liquid |
| | 3-IODO-4-NITROTOLUENE Preparation Products And Raw materials |
|