|
|
| | tert-butyl N-{3-aminobicyclo[1.1.1]pentan-1-yl}carbamate Basic information |
| Product Name: | tert-butyl N-{3-aminobicyclo[1.1.1]pentan-1-yl}carbamate | | Synonyms: | tert-butyl N-{3-aminobicyclo[1.1.1]pentan-1-yl}carbamate;N-(3-Aminobicyclo[1.1.1]pent-1-yl)carbamic acid 1,1-dimethylethyl ester;N-(3-aminobicyclo[1.1.1]pent-1-yl)-Carbamic acid, 1,1-dimethylethyl ester;tert-Butyl (3-aminobicyclo[1.1.1]pent-1-yl)carbamate;N1-Boc-bicyclo[1.1.1]pentane-1,3-diamine;Carbamic acid, N-(3-aminobicyclo[1.1.1]pent-1-yl)-, 1,1-dimethylethyl ester;(3-Amino-bicyclo[1.1.1]pent-1-yl)-carbamic acid tert-butyl e...;(3-Amino-bicyclo[1.1.1]pent-1-yl)-carbamic acid tert-butyl ester | | CAS: | 1638767-25-5 | | MF: | C10H18N2O2 | | MW: | 198.26 | | EINECS: | | | Product Categories: | | | Mol File: | 1638767-25-5.mol | ![tert-butyl N-{3-aminobicyclo[1.1.1]pentan-1-yl}carbamate Structure](CAS/GIF/1638767-25-5.gif) |
| | tert-butyl N-{3-aminobicyclo[1.1.1]pentan-1-yl}carbamate Chemical Properties |
| Melting point | 122 °C | | Boiling point | 288.9±39.0 °C(Predicted) | | density | 1.14±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 9.98±0.20(Predicted) | | Appearance | White to light yellow Solid | | Sensitive | Air Sensitive | | InChI | InChI=1S/C10H18N2O2/c1-8(2,3)14-7(13)12-10-4-9(11,5-10)6-10/h4-6,11H2,1-3H3,(H,12,13) | | InChIKey | WDWZFRPJPZEOBM-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC12CC(N)(C1)C2 |
| | tert-butyl N-{3-aminobicyclo[1.1.1]pentan-1-yl}carbamate Usage And Synthesis |
| Chemical Properties | White to Light yellow powder to crystal |
| | tert-butyl N-{3-aminobicyclo[1.1.1]pentan-1-yl}carbamate Preparation Products And Raw materials |
|