|
|
| | Sacubitril Impurity Basic information |
| Product Name: | Sacubitril Impurity | | Synonyms: | (2E,4S)-5-[1,1-Biphenyl]-4-yl-4-[[(1,1-dimethylethoxy)carbonyl]amino]-2-methyl-2-pentenoic Acid;2-Pentenoic acid, 5-[1,1'-biphenyl]-4-yl-4-[[(1,1-dimethylethoxy)carbonyl]amino]-2-methyl-, (2E,4S)-;impurity 41;Sacubitril Impurity;(S,E)-5-([1,1'-Biphenyl]-4-yl)-4-((tert-butoxycarbonyl)amino)-2-methylpent-2-enoic acid;Sacubitril Impurity 103;(2E,4S)-5-[1,1'-Biphenyl]-4-yl-4-[[(1,1-dimethylethoxy)carbonyl]amino]-2-methyl-2-pentenoic acid;LCZ696 valsartan + sacubitril impurity 41 | | CAS: | 1015037-46-3 | | MF: | C23H27NO4 | | MW: | 381.46 | | EINECS: | | | Product Categories: | | | Mol File: | 1015037-46-3.mol |  |
| | Sacubitril Impurity Chemical Properties |
| Boiling point | 595.6±50.0 °C(Predicted) | | density | 1.132±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 4.67±0.19(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C23H27NO4/c1-16(21(25)26)14-20(24-22(27)28-23(2,3)4)15-17-10-12-19(13-11-17)18-8-6-5-7-9-18/h5-14,20H,15H2,1-4H3,(H,24,27)(H,25,26)/b16-14+/t20-/m1/s1 | | InChIKey | JXTNUXJSXXIIFE-KETLNSEPSA-N | | SMILES | C(O)(=O)/C(/C)=C/[C@@H](NC(OC(C)(C)C)=O)CC1=CC=C(C2=CC=CC=C2)C=C1 |
| | Sacubitril Impurity Usage And Synthesis |
| Uses | (2E,4S)-5-[1,1''-Biphenyl]-4-yl-4-[[(1,1-dimethylethoxy)carbonyl]amino]-2-methyl-2-pentenoic Acid was used in the study to process for preparation of biaryl-substituted 4-aminobutyric acids by hydrogenation of the corresponding alkenoates. |
| | Sacubitril Impurity Preparation Products And Raw materials |
|