|
|
| | 1,2,3,3-Tetramethyl-3H-indolium iodide Basic information |
| Product Name: | 1,2,3,3-Tetramethyl-3H-indolium iodide | | Synonyms: | AURORA KA-286;1,2,3,3-TETRAMETHYL-3H-INDOLIUM IODIDE;1,2,3,3-TETRAMETHYL-INDOLENINIUM-IODIDE;1,2,3,3-tetramethyl-3h-indoliuiodide;,2,3,3-TETRAMETHYL-3H-INDOLIUM IODIDE;1,2,3,3-tetramethyl-3H-indolinium iodide;1,2,3,3-Tetramethyl-;1,2,3,3-TetraMethyl-3H-indol-1-iuM iodide | | CAS: | 5418-63-3 | | MF: | C12H16IN | | MW: | 301.17 | | EINECS: | 226-526-2 | | Product Categories: | Stains and Dyes;Stains&Dyes, A to;T-U-V | | Mol File: | 5418-63-3.mol |  |
| | 1,2,3,3-Tetramethyl-3H-indolium iodide Chemical Properties |
| Melting point | 258 °C (dec.)(lit.) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | methanol: 25mg/mL, clear | | form | powder or crystals | | Appearance | Off-white to pink Solid | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | InChI=1S/C12H16N.HI/c1-9-12(2,3)10-7-5-6-8-11(10)13(9)4;/h5-8H,1-4H3;1H/q+1;/p-1 | | InChIKey | HCYIOKVZAATOEW-UHFFFAOYSA-M | | SMILES | C12C=CC=CC=1C(C(C)=[N+]2C)(C)C.[I-] | | EPA Substance Registry System | 3H-Indolium, 1,2,3,3-tetramethyl-, iodide (5418-63-3) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | NM2251250 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,2,3,3-Tetramethyl-3H-indolium iodide Usage And Synthesis |
| Uses | 1,2,3,3-Tetramethyl-3H-indolium Iodide can be used in the preparation of fluorophore-dapagliflozin dyad for diabetic liver/kidney damage fluorescent imaging and therapy via SGLT2 inhibition. It can also be useful in the preparation of N-alkylated linear heptamethine polyenes as potential antifungals. |
| | 1,2,3,3-Tetramethyl-3H-indolium iodide Preparation Products And Raw materials |
| Preparation Products | 1,3,3-TRIMETHYLINDOLINOBENZOPYRYLOSPIRAN-->1,3,3-Trimethyl-2-methyleneindoline-->2-[(1E,3Z)-3-CHLORO-5-(1,3,3-TRIMETHYL-1,3-DIHYDRO-2H-INDOL-2-YLIDENE)-1,3-PENTADIENYL]-1,3,3-TRIMETHYL-3H-INDOLIUM IODIDE |
|