|
|
| | 4,4'-Dicarboxydiphenyl Ether Basic information |
| Product Name: | 4,4'-Dicarboxydiphenyl Ether | | Synonyms: | Diphenyl Ether 4,4'-Dicarboxylic Acid
4,4'-Oxobisbenzoic Acid;4,4'-Dicarboxylic Diphenyl Ether;Oxybis(benzoic ac;Oxybisbenzoic acid(OBBA);Oxybisbenzoic acid;Oxybisenzoic acid;Benzoicacid,4,4’-oxybis-;4,4'-DIPHENYL ETHER DICARBOXYLIC ACID | | CAS: | 2215-89-6 | | MF: | C14H10O5 | | MW: | 258.23 | | EINECS: | 218-683-0 | | Product Categories: | Carboxylic Acid Monomers;Monomers;Diphenyl Ethers (for High-Performance Polymer Research);Functional Materials;Reagent for High-Performance Polymer Research;Polymer Science;Industrial/Fine Chemicals;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Aromatic Ethers;1;2215-89-6 | | Mol File: | 2215-89-6.mol |  |
| | 4,4'-Dicarboxydiphenyl Ether Chemical Properties |
| Melting point | 329 °C | | Boiling point | 256-259 °C | | density | 1.395±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Water Solubility | Insoluble in water | | form | powder to crystal | | pka | 3.94±0.10(Predicted) | | color | White to Almost white | | BRN | 2218315 | | InChI | InChI=1S/C14H10O5/c15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18/h1-8H,(H,15,16)(H,17,18) | | InChIKey | WVDRSXGPQWNUBN-UHFFFAOYSA-N | | SMILES | O(C1=CC=C(C=C1)C(O)=O)C1=CC=C(C=C1)C(O)=O | | CAS DataBase Reference | 2215-89-6(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 4,4'-oxybis- (2215-89-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids |
| | 4,4'-Dicarboxydiphenyl Ether Usage And Synthesis |
| Description | 4,4'-Dicarboxydiphenyl Ether (DCPE) is a polymer raw material that can undergo polycondensation with terephthalic acid (TA) to produce poly(aryl ether benzimidazole) copolymers for use in high-temperature fuel cell membranes. | | Chemical Properties | White to pale brown solid | | Uses | 4,4'-oxybisbenzoic acid is a monomeric liquid crystal polymer. it is used widely in the electronics and pharmaceutical industries. Preparation of whole Polyarylate thermoplastic liquid crystal polymer (TLCP), also can be used to prepare high strength, high modulus of liquid crystal fibers, specialty plastics and polymer flame retardants in industrial. also as a non-liquid crystal polymer additives, reduce baking temperature and viscosity of the polymer to facilitate processing and made of an insulating material. | | Reactions | Based on Friedel–Crafts acylation, nonstoichiometric polycondensation was achieved using 4,4'-Dicarboxydiphenyl Ether and 2,2′-dimethoxybiphenyl in trifluoromethanesulfonic acid[1].
 | | Synthesis | 4,4'-Oxybisbenzoic acid can be prepared by reacting 4-chlorobenzoic acid and 4-hydroxybenzoic acid under certain conditions. | | References | [1] Matsumoto, K., Ogawa, T., Jikei, M. (2017). Nonstoichiometric polycondensation based on Friedel–Crafts acylation in superacids for the syntheses of aromatic polyketones?. Polymer Chemistry, 47, 7297–7300. https://doi.org/10.1039/C7PY01609C |
| | 4,4'-Dicarboxydiphenyl Ether Preparation Products And Raw materials |
|