|
|
| | METHENAMINE MANDELATE Basic information |
| Product Name: | METHENAMINE MANDELATE | | Synonyms: | METHENAMINE MANDELATE;METHENAMINE MANDELATE SALT;HEXAMINE MANDELATE SALT;HEXAMETHYLENETETRAMINE MANDELATE;HEXAMETHYLENETETRAMINE MANDELATE SALT;1,3,5,7-TETRAAZATRICYCLO-[3.3.1.1(3)(7)]DECANE MANDELATE SALT;HEXAMINEMANDELATE;Methenamine Mandelate (200 mg) | | CAS: | 587-23-5 | | MF: | C14H20N4O3 | | MW: | 292.33 | | EINECS: | 209-597-4 | | Product Categories: | Heterocyclic Compounds | | Mol File: | 587-23-5.mol |  |
| | METHENAMINE MANDELATE Chemical Properties |
| Melting point | 128-130° | | Fp | 250℃ | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C8H8O3.C6H12N4/c9-7(8(10)11)6-4-2-1-3-5-6;1-7-2-9-4-8(1)5-10(3-7)6-9/h1-5,7,9H,(H,10,11);1-6H2 | | InChIKey | UXNFIJPHRQEWRQ-UHFFFAOYSA-N | | SMILES | C1N2CN3CN1CN(C2)C3.OC(C(O)=O)c4ccccc4 | | CAS DataBase Reference | 587-23-5(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2933690000 | | Storage Class | 11 - Combustible Solids |
| | METHENAMINE MANDELATE Usage And Synthesis |
| Uses | Antibacterial (urinary). | | Uses | Methenamine Mandelate acts as an antibacterial agent. | | Indications | Methenamine mandelate is a synthetic antibacterial agent that, when applied to
the skin, hydrolyzes to ammonia and formaldehyde. A 5% methenamine stick
or a 10% solution is effective in mild to moderate hyperhidrosis and rarely
produces allergic reactions. | | Brand name | Mandelamine (Parke-Davis). | | Clinical Use | Hexamethylenetetramine mandelate (Methenamine) is awhite crystalline powder with a sour taste and practically noodor. It is very soluble in water and has the advantage ofproviding its own acidity, although in its use, the custom isto carry out a preliminary acidification of the urine for 24 to36 hours before administration. |
| | METHENAMINE MANDELATE Preparation Products And Raw materials |
|