| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:(±)-1-Phenylethan--d3-ol
CAS:17537-32-5
Remarks:CS-C-02701
|
| Company Name: |
ChengDu SinoStandards Bio-Tech Co.,Ltd. ，
|
| Tel: |
028-83243028 19136088901 |
| Email: |
sinostandards@163.com |
| Products Intro: |
Product Name:(±)-1-Phenylethan-2,2,2-d3-ol
CAS:17537-32-5
Purity:標(biāo)準(zhǔn)品 Package:10mg;100mg;1g
|
| Company Name: |
Yancheng Tongming Biotechnology Co., Ltd.
|
| Tel: |
15195160625 |
| Email: |
2863565288@qq.com |
| Products Intro: |
Product Name:(±)-1-Phenylethan-2,2,2-d3-ol
CAS:17537-32-5
Purity:98% HPLC Package:0.5 g In Stock
1 g In Stock
|
| Company Name: |
LGC Science (Shanghai) Ltd.
|
| Tel: |
17717235263 |
| Email: |
offer.de@lgcgroup.com |
| Products Intro: |
Product Name:(±)-1-Phenylethan-2,2,2-d3-ol
CAS:17537-32-5
Purity:具體純度，見COA Package:0.5g Remarks:CDN-D-0627
|
|
| | 1-PHENYLETHAN-2,2,2-D3-OL Basic information |
| Product Name: | 1-PHENYLETHAN-2,2,2-D3-OL | | Synonyms: | (±)-1-Phenylethan--d3-ol;SEC-PHENETHYL-BETA BETA BETA-D3 ALCOHOL;1-PHENYLETHAN-2,2,2-D3-OL;1-PHENYLETHANOL-2,2,2-D3;SEC-PHENETHYL-BETA,BETA,BETA-D3 ALCOHOL, 98 ATOM % D;sec-phenethyl-β,β,β-d3alcohol;1-Phenylethanol-2,2,2-d3;(±)-1-Phenylethan-2,2,2-d3-ol | | CAS: | 17537-32-5 | | MF: | C8H7D3O | | MW: | 125.18 | | EINECS: | | | Product Categories: | | | Mol File: | 17537-32-5.mol |  |
| | 1-PHENYLETHAN-2,2,2-D3-OL Chemical Properties |
| Melting point | 19-20 °C(lit.) | | Boiling point | 204 °C745 mm Hg(lit.) | | density | 1.048 g/mL at 25 °C | | refractive index | n20/D 1.532(lit.) | | Fp | 185 °F | | InChI | 1S/C8H10O/c1-7(9)8-5-3-2-4-6-8/h2-7,9H,1H3/i1D3 | | InChIKey | WAPNOHKVXSQRPX-FIBGUPNXSA-N | | SMILES | [2H]C([2H])([2H])C(O)c1ccccc1 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38-36/38-21/22 | | Safety Statements | 26-28-36/37/39-45-36/37 | | RIDADR | UN 2937 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | 1-PHENYLETHAN-2,2,2-D3-OL Usage And Synthesis |
| Uses | (±)-1-Phenylethan-2,2,2-d3-ol (CAS# 17537-32-5) is a useful isotopically labeled research compound. |
| | 1-PHENYLETHAN-2,2,2-D3-OL Preparation Products And Raw materials |
|