1-Bromo-2-chloro-5,6-difluorobenzene manufacturers
|
| | 1-Bromo-2-chloro-5,6-difluorobenzene Basic information |
| Product Name: | 1-Bromo-2-chloro-5,6-difluorobenzene | | Synonyms: | 1-Bromo-2-chloro-5,6-difluorobenzene;2-Bromo-1-chloro-3,4-difluorobenzene;2,3-Difluoro-6-chlorobromobenzene;1-Bromo-6-chloro-2,3-difluorobenzene;Benzene, 2-bromo-1-chloro-3,4-difluoro-;6-chloro-2,3-difluorobromobenzene | | CAS: | 1208077-25-1 | | MF: | C6H2BrClF2 | | MW: | 227.43 | | EINECS: | | | Product Categories: | | | Mol File: | 1208077-25-1.mol |  |
| | 1-Bromo-2-chloro-5,6-difluorobenzene Chemical Properties |
| Boiling point | 198.5±35.0 °C(Predicted) | | density | 1.805±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C6H2BrClF2/c7-5-3(8)1-2-4(9)6(5)10/h1-2H | | InChIKey | MWGRISBCIIDKSD-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=C(F)C(F)=C1Br |
| | 1-Bromo-2-chloro-5,6-difluorobenzene Usage And Synthesis |
| | 1-Bromo-2-chloro-5,6-difluorobenzene Preparation Products And Raw materials |
|