|
|
| | M-ISOBUTYL IBUPROFEN Basic information |
| | M-ISOBUTYL IBUPROFEN Chemical Properties |
| Boiling point | 314.8±11.0 °C(Predicted) | | density | 1.029±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | pka | 4.35±0.10(Predicted) | | color | Colourless | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C13H18O2/c1-9(2)7-11-5-4-6-12(8-11)10(3)13(14)15/h4-6,8-10H,7H2,1-3H3,(H,14,15) | | InChIKey | SFVKLYXPBKITCE-UHFFFAOYSA-N | | SMILES | OC(=O)C(C)c1cc(ccc1)CC(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | M-ISOBUTYL IBUPROFEN Usage And Synthesis |
| Uses | m-Isobutyl Ibuprofen (Ibuprofen EP Impurity A) is an Ibuprofen (I140000) impurity used in the study of potent noncompetitive interleukin-8 inhibitors. | | Uses | m-Isobutyl Ibuprofen is an Ibuprofen (I140000) impurity used in the study of potent noncompetitive interleukin-8 inhibitors. | | Synthesis Reference(s) | Synthesis, p. 444, 1983 DOI: 10.1055/s-1983-30369 |
| | M-ISOBUTYL IBUPROFEN Preparation Products And Raw materials |
|