| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Icosafluoro-1-decene
CAS:35328-43-9
|
|
| | PERFLUORODECENE-1 Basic information |
| Product Name: | PERFLUORODECENE-1 | | Synonyms: | PERFLUORODECENE-1;PERFLUORODEC-1-ENE;PERFLUORDECENE-1;1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Icosafluoro-1-decene;Perfluorodec-1-ene 95%;1-Decene, 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-eicosafluoro-;perfluorodecene;Perfluoro-1-decene | | CAS: | 35328-43-9 | | MF: | C10F20 | | MW: | 500.08 | | EINECS: | 252-514-1 | | Product Categories: | | | Mol File: | 35328-43-9.mol |  |
| | PERFLUORODECENE-1 Chemical Properties |
| Boiling point | 153.3±8.0 °C(Predicted) | | density | 1.688±0.06 g/cm3(Predicted) | | InChI | 1S/C10F20/c11-1(2(12)13)3(14,15)4(16,17)5(18,19)6(20,21)7(22,23)8(24,25)9(26,27)10(28,29)30 | | InChIKey | IMVVEWPCRIJQCA-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=C(F)F)F | | EPA Substance Registry System | Perfluoro-1-decene (35328-43-9) |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | Storage Class | 10 - Combustible liquids |
| | PERFLUORODECENE-1 Usage And Synthesis |
| Uses | Perfluorodecene-1 (CAS# 35328-43-9) is a perfluoroalkane, a group of emerging pollutants. Perfluorodecene-1 has been used as a tuning modifier in synthesized membranes for oil-soluble drugs, modifying the pore size, porosity, surface area, surface roughness, and super-hydrophobicity. |
| | PERFLUORODECENE-1 Preparation Products And Raw materials |
|