1,2-DIPHENYLVINYLENE CARBONATE manufacturers
|
| | 1,2-DIPHENYLVINYLENE CARBONATE Basic information |
| Product Name: | 1,2-DIPHENYLVINYLENE CARBONATE | | Synonyms: | 1,2-DIPHENYLVINYLENE CARBONATE;1,2-DIPHENYL VINYLIDENE CARBONATE;4,5-diphenyl-1,3-dioxolan-2-one;1,3-Dioxol-2-one, 4,5-diphenyl-;Benzoin cyclic carbonate;4,5-DIPHENYL-1,3-DIOXOL-2-ONE 98+%;BENZOIN CARBONATE;4,5-DIPHENYL-1,3-DIOXOL-2-ONE | | CAS: | 21240-34-6 | | MF: | C15H10O3 | | MW: | 238.24 | | EINECS: | 244-287-2 | | Product Categories: | Heterocyclic Compounds | | Mol File: | 21240-34-6.mol |  |
| | 1,2-DIPHENYLVINYLENE CARBONATE Chemical Properties |
| Melting point | 71-75 °C(lit.) | | Boiling point | 366.3±52.0 °C(Predicted) | | density | 1.288±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | form | solid | | Appearance | Off-white to light yellow Solid | | BRN | 1114120 | | InChI | 1S/C15H10O3/c16-15-17-13(11-7-3-1-4-8-11)14(18-15)12-9-5-2-6-10-12/h1-10H | | InChIKey | SROHGOJDCAODGI-UHFFFAOYSA-N | | SMILES | O=C1OC(=C(O1)c2ccccc2)c3ccccc3 | | CAS DataBase Reference | 21240-34-6(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 8 | | Storage Class | 11 - Combustible Solids |
| | 1,2-DIPHENYLVINYLENE CARBONATE Usage And Synthesis |
| Chemical Properties | White crystals. Melting point 75-76 ℃. Soluble in ethanol, insoluble in water. | | Uses | 4,5-Diphenyl-1,3-dioxol-2-one is used as an organic synthesis intermediates. | | Synthesis | 4,5-Diphenyl-1,3-dioxol-2-one can be prepared by reacting benzoin and phosgene with N,N-dimethylaniline as a catalyst. |
| | 1,2-DIPHENYLVINYLENE CARBONATE Preparation Products And Raw materials |
|