|
|
| | 5-NITRONICOTINIC ACID Basic information |
| | 5-NITRONICOTINIC ACID Chemical Properties |
| Melting point | 171-173 | | Boiling point | 369.5±27.0 °C(Predicted) | | density | 1.570±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 2.75±0.10(Predicted) | | color | Light Yellow to Dark Yellow | | InChI | InChI=1S/C6H4N2O4/c9-6(10)4-1-5(8(11)12)3-7-2-4/h1-3H,(H,9,10) | | InChIKey | TZAGBVHIUUFVCJ-UHFFFAOYSA-N | | SMILES | C1=NC=C([N+]([O-])=O)C=C1C(O)=O | | CAS DataBase Reference | 2047-49-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | Hazard Note | Irritant | | HS Code | 29349990 |
| | 5-NITRONICOTINIC ACID Usage And Synthesis |
| Chemical Properties | Yellow-brown powder | | Uses | An intermediate in the synthesis of nicotinamide with potential anticoccidial activity. |
| | 5-NITRONICOTINIC ACID Preparation Products And Raw materials |
|