|
|
| | 3,6-Dihydroxyphthalonitrile Basic information |
| Product Name: | 3,6-Dihydroxyphthalonitrile | | Synonyms: | 1,4-DIHYDROXY-2,3-DICYANO BENZENE;2,3-DICYANO-1,4-HYDROQUINONE;3,6-DIHYDROXYPHTHALODINITRILE;3,6-DIHYDROXYPHTHALONITRILE;RARECHEM AQ BD 0015;1,2-Benzenedicarbonitrile, 3,6-dihydroxy-;3,6-DIHYDROXYPHTHONITRILE;2,3-DICYANOHYDROQUINONE, 97+% | | CAS: | 4733-50-0 | | MF: | C8H4N2O2 | | MW: | 160.13 | | EINECS: | 225-241-0 | | Product Categories: | API intermediates;Functional Materials;Anthraquinones, Hydroquinones and Quinones;Phthalonitriles & Naphthalonitriles;Phthalonitriles (Building Blocks for Phthalocyanines) | | Mol File: | 4733-50-0.mol |  |
| | 3,6-Dihydroxyphthalonitrile Chemical Properties |
| Melting point | >230 °C (dec.) (lit.) | | Boiling point | 286.01°C (rough estimate) | | density | 1.3848 (rough estimate) | | refractive index | 1.4900 (estimate) | | storage temp. | Store below +30°C. | | form | Crystalline Powder or Needles | | pka | 6.21±0.23(Predicted) | | color | Khaki to brown | | Water Solubility | Soluble in hot water | | BRN | 2101249 | | InChI | InChI=1S/C8H4N2O2/c9-3-5-6(4-10)8(12)2-1-7(5)11/h1-2,11-12H | | InChIKey | MPAIWVOBMLSHQA-UHFFFAOYSA-N | | SMILES | C1(C#N)=C(O)C=CC(O)=C1C#N | | CAS DataBase Reference | 4733-50-0(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-37/39-36/37/39 | | RIDADR | UN 2811 6.1/PG III | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | 3,6-Dihydroxyphthalonitrile Usage And Synthesis |
| Chemical Properties | khaki-colored to brown crystalline powder or | | Uses | 2,3-Dicyanohydroquinone was used in the synthesis of phthalonitrile-3,6-ditriflate. It is a fluorescent dye and was used in determination of intracellular pH and calcium in avian neural crest cells. |
| | 3,6-Dihydroxyphthalonitrile Preparation Products And Raw materials |
| Raw materials | 2,5-DIHYDROXYBENZONITRILE-->1,4-Benzoquinone-->HYDROGEN CYANIDE | | Preparation Products | 2,3-Dichloro-5,6-dicyano-1,4-benzoquinone-->1,4,8,11,15,18,22,25-OCTABUTOXY- PHTHALOCYANINE-->3,6-BIS(DECYL)PHTHALONITRILE-->3,6-DIACETOXYPHTHALIC ACID ANHYDRIDE |
|