- HT-2 Toxin
-
-
2026-05-11
- CAS:26934-87-2
- Purity:
- Supply Ability: 10g
|
| | HT-2 TOXIN Basic information |
| Product Name: | HT-2 TOXIN | | Synonyms: | Trichothen-9-ene-3,4,8,15-tetrol, 12,13-epoxy-, 15-acetate 8-(3-methylbutanoate);HT-2 TOXIN;15-ACETOXY-3ALPHA,4BETA-DIHYDROXY-8ALPHA-[3-METHYLBUTYRYLOXY]-12,13-EPOXYTRICHOTHEC-9-ENE;15-acetoxy-3α,4β-dihydroxy-8α-(3-methylbutyryloxy)-12,13-epoxytrichothec-9-ene;ht-2toxin solution;15-Acetoxy-3alpha-4beta-dihydoxy-8alpha-(3-methylbutyryloxy)-12,13-epoxytrichothec-9-ene;Pentanoic acid anion;12,13-Epoxytrichothec-9-ene-3α,4β,8α,15-tetrol 15-acetate 8-(3-methylbutanoate) | | CAS: | 26934-87-2 | | MF: | C22H32O8 | | MW: | 424.48 | | EINECS: | 621-720-7 | | Product Categories: | HA -HTBiotoxins;Alphabetic;H;Mycotoxins;Single component solutions;antibiotic | | Mol File: | 26934-87-2.mol |  |
| | HT-2 TOXIN Chemical Properties |
| Boiling point | 537.1±50.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | Fp | 2 °C | | storage temp. | −20°C | | solubility | Dichloromethane: 5 mg/ml; DMSO: soluble; Ethanol: soluble | | form | White to slight yellow solid. | | pka | 13.56±0.70(Predicted) | | color | White to off-white | | Stability: | Hygroscopic | | Major Application | cleaning products
cosmetics
food and beverages
personal care | | InChIKey | PNKLMTPXERFKEN-ZIOSACBISA-N | | SMILES | CC(C)CC(=O)O[C@H]1C[C@@]2(COC(C)=O)[C@H](O[C@@H]3[C@H](O)[C@@H](O)C2(C)C34CO4)C=C1C |
| Hazard Codes | T+,T,Xn,F | | Risk Statements | 26/27/28-36/37/38-36-20/21/22-11 | | Safety Statements | 22-26-36/37/39-45-36/37-16 | | RIDADR | UN 3462 6.1/PG 1 | | WGK Germany | 3 | | RTECS | YD0050000 | | HazardClass | 6.1(a) | | PackingGroup | I | | HS Code | 29329990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Flam. Liq. 2 |
| | HT-2 TOXIN Usage And Synthesis |
| Chemical Properties | White Powder | | Uses | HT-2 Toxin is a trichothecene group mycotoxin. HT-2 Toxin is the 4-hydroxy analogue of T-2 Toxin (T002980) which has been shown to induce DNA damage and cell death on prolonged administration. | | Definition | ChEBI: HT-2 toxin is a trichothecene mycotoxin that is T-2 toxin in which the acetyloxy group at position 4S has been hydrolysed to the corresponding hydroxy group. It is the major metabolite of T-2 toxin. It has a role as a fungal metabolite and an apoptosis inducer. It is a trichothecene, an organic heterotetracyclic compound and an acetate ester. |
| | HT-2 TOXIN Preparation Products And Raw materials |
|