| Company Name: |
SobhaBio
|
| Tel: |
+91-7036227677 +91-9989882177 |
| Email: |
sales@sobhabio.com |
| Products Intro: |
Product Name:Methyl-3,6-dichloro benzo[b]thiophene-2-carboxylate
CAS:21211-18-7
Purity:98% Package:1Kg,10Kg,50Kg,100Kg
|
METHYL 3 6-DICHLOROBENZO(B)THIOPHENE-2-& manufacturers
|
| | METHYL 3 6-DICHLOROBENZO(B)THIOPHENE-2-& Basic information |
| Product Name: | METHYL 3 6-DICHLOROBENZO(B)THIOPHENE-2-& | | Synonyms: | METHYL 3 6-DICHLOROBENZO(B)THIOPHENE-2-&;Methyl 3,6-di chlorobenzo thiophene-2-carboxylate;Methyl 3,6-dichlorobenzo[b]thiophene-2-carboxylate 97%;3,6-dichloro-2-benzothiophenecarboxylic acid methyl ester;3,6-dichlorobenzothiophene-2-carboxylic acid methyl ester;methyl 3,6-dichloro-1-benzothiophene-2-carboxylate;benzo[b]thiophene-2-carboxylic acid, 3,6-dichloro-, methyl;JR-6655, Methyl 3,6-dichlorobenzo[b]thiophene-2-carboxylate, 97% | | CAS: | 21211-18-7 | | MF: | C10H6Cl2O2S | | MW: | 261.13 | | EINECS: | | | Product Categories: | Benzothiophenes;BenzothiophenesHeterocyclic Building Blocks;Building Blocks;Halogenated Heterocycles;Heterocyclic Building Blocks | | Mol File: | 21211-18-7.mol |  |
| | METHYL 3 6-DICHLOROBENZO(B)THIOPHENE-2-& Chemical Properties |
| Melting point | 130-134 °C(lit.) | | Boiling point | 371.242±37.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.494±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | solid | | InChI | 1S/C10H6Cl2O2S/c1-14-10(13)9-8(12)6-3-2-5(11)4-7(6)15-9/h2-4H,1H3 | | InChIKey | ZVRUOIZSXBNGBH-UHFFFAOYSA-N | | SMILES | COC(=O)c1sc2cc(Cl)ccc2c1Cl |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 4 |
| | METHYL 3 6-DICHLOROBENZO(B)THIOPHENE-2-& Usage And Synthesis |
| | METHYL 3 6-DICHLOROBENZO(B)THIOPHENE-2-& Preparation Products And Raw materials |
|