|
|
| | 2,2-Diethoxy-N,N-dimethylethylamine Basic information |
| Product Name: | 2,2-Diethoxy-N,N-dimethylethylamine | | Synonyms: | 2,2-Diethoxy-N,N-dimethylethanamine;Dimethylamionacetaldehydediethylacetal;2,2-DIETHOXY-1-DIMETHYLAMINOETHANE;2,2-DIETHOXY-N,N-DIMETHYLETHYLAMINE;2-(DIMETHYLAMINO)-ACETALDEHYDE DIETHYLACETAL;N-(2,2-DIETHOXYETHYL)DIMETHYLAMINE;2,2-Diethyoxy-N,N-dimethylethylamine;2-Dimethylaminoacetaldehyde diethy acetal | | CAS: | 3616-56-6 | | MF: | C8H19NO2 | | MW: | 161.24 | | EINECS: | 222-800-0 | | Product Categories: | Acetals/Ketals/Ortho Esters;Building Blocks;API intermediates;Chemical Synthesis;Organic Building Blocks;Oxygen Compounds;Miscellaneous | | Mol File: | 3616-56-6.mol |  |
| | 2,2-Diethoxy-N,N-dimethylethylamine Chemical Properties |
| Boiling point | 170 °C (lit.) | | density | 0.883 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.411(lit.) | | Fp | 113 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | clear liquid | | pka | 9.35±0.28(Predicted) | | color | Colorless to Almost colorless | | BRN | 1739149 | | InChI | InChI=1S/C8H19NO2/c1-5-10-8(11-6-2)7-9(3)4/h8H,5-7H2,1-4H3 | | InChIKey | SSFAUOAQOOISRQ-UHFFFAOYSA-N | | SMILES | C(N(C)C)C(OCC)OCC | | CAS DataBase Reference | 3616-56-6(CAS DataBase Reference) | | NIST Chemistry Reference | Ethanamine, 2,2-diethoxy-N,N-dimethyl-(3616-56-6) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36/37/39 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29221990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | 2,2-Diethoxy-N,N-dimethylethylamine Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | Dimethylaminoacetaldehyde Diethyl Acetal is used in the preparation of biindoles via copper-mediated regioselective dehydrogenative homocoupling of N-pyrimidyl indoles. |
| | 2,2-Diethoxy-N,N-dimethylethylamine Preparation Products And Raw materials |
|