|
|
| | 2-(Boc-aminomethyl)phenylacetic acid Basic information |
| | 2-(Boc-aminomethyl)phenylacetic acid Chemical Properties |
| Boiling point | 435.2±33.0 °C(Predicted) | | density | 1.163±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 4.26±0.10(Predicted) | | Appearance | White to off-white Solid | | BRN | 1080474 | | Major Application | peptide synthesis | | InChI | 1S/C14H19NO4/c1-14(2,3)19-13(18)15-9-11-7-5-4-6-10(11)8-12(16)17/h4-7H,8-9H2,1-3H3,(H,15,18)(H,16,17) | | InChIKey | CGPQRFCFBISLKF-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)NCc1ccccc1CC(O)=O | | CAS DataBase Reference | 40851-66-9(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 2-(Boc-aminomethyl)phenylacetic acid Usage And Synthesis |
| Uses | [2-(tert-Butoxycarbonylaminomethyl)phenyl]acetic Acid is used to study molecular modeling on oligomers built from 2-aminomethylphenylacetic acid. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | 2-(Boc-aminomethyl)phenylacetic acid Preparation Products And Raw materials |
|