|
|
| | Ethyl 5-oxo-1-phenyl-2-pyrazoline-3-carboxylate Basic information |
| Product Name: | Ethyl 5-oxo-1-phenyl-2-pyrazoline-3-carboxylate | | Synonyms: | 1-Phenyl-5-oxo-2-pyrazoline-3-carboxylicacid,ethylester;4,5-dihydro-5-oxo-1-phenyl-1h-pyrazole-3-carboxylicaciethylester;1-PHENYL-5-PYRAZOLONE-3-CARBOXYLIC ACID ETHYL ESTER;1-PHENYL-3-ETHOXYCARBONYL-5-PYRAZALONE;1-PHENYL-3-CARBETHOXY-5-PYRAZOLONE;1H-PYRAZOLE-3-CARBOXYLIC ACID 4,5-DIHYDRO-5-OXO-1-PHENYL, ETHYL ESTER;ethyl 5-oxo-1-phenyl-2-pyrazoline-3-carboxylate;ethyl 5-oxo-1-phenyl-4,5-dihydro-1H-pyrazole-3-carboxylate | | CAS: | 89-33-8 | | MF: | C12H12N2O3 | | MW: | 232.24 | | EINECS: | 201-899-4 | | Product Categories: | Intermediates of Dyes and Pigments | | Mol File: | 89-33-8.mol |  |
| | Ethyl 5-oxo-1-phenyl-2-pyrazoline-3-carboxylate Chemical Properties |
| Melting point | 181.5-182.5 °C | | Boiling point | 335.3±25.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | vapor pressure | 0.001Pa at 20℃ | | storage temp. | Sealed in dry,Room Temperature | | form | Powder | | pka | -0.36±0.50(Predicted) | | InChI | InChI=1S/C12H12N2O3/c1-2-17-12(16)10-8-11(15)14(13-10)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 | | InChIKey | WBFXQKNQVZMOSQ-UHFFFAOYSA-N | | SMILES | N1(C2=CC=CC=C2)C(=O)CC(C(OCC)=O)=N1 | | LogP | 2 at 23℃ and pH8.5 | | CAS DataBase Reference | 89-33-8(CAS DataBase Reference) | | NIST Chemistry Reference | 1H-pyrazole-3-carboxylic acid, 4,5-dihydro-5-oxo-1-phenyl-, ethyl ester(89-33-8) | | EPA Substance Registry System | 1H-Pyrazole-3-carboxylic acid, 4,5-dihydro-5-oxo-1-phenyl-, ethyl ester (89-33-8) |
| Provider | Language |
|
ALFA
| English |
| | Ethyl 5-oxo-1-phenyl-2-pyrazoline-3-carboxylate Usage And Synthesis |
| Chemical Properties | light yellow crystalline powder |
| | Ethyl 5-oxo-1-phenyl-2-pyrazoline-3-carboxylate Preparation Products And Raw materials |
|