- N-Boc-L-alanine
-
-
2026-07-24
- CAS:15761-38-3
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 1000kgs
|
| | N-(tert-Butoxycarbonyl)-L-alanine Basic information |
| | N-(tert-Butoxycarbonyl)-L-alanine Chemical Properties |
| Melting point | 79-83 °C(lit.) | | Boiling point | 324.46°C (rough estimate) | | alpha | -26 º (c=2, acetic acid) | | density | 1.2321 (rough estimate) | | refractive index | -25.5 ° (C=2, AcOH) | | storage temp. | Sealed in dry,2-8°C | | solubility | DMSO, Methanol | | pka | 4.02±0.10(Predicted) | | form | Granular Powder | | color | White | | Optical Rotation | [α]20/D 25±1°, c = 2% in acetic acid | | BRN | 1726365 | | Major Application | peptide synthesis | | InChI | InChI=1S/C8H15NO4/c1-5(6(10)11)9-7(12)13-8(2,3)4/h5H,1-4H3,(H,9,12)(H,10,11)/t5-/m0/s1 | | InChIKey | QVHJQCGUWFKTSE-YFKPBYRVSA-N | | SMILES | C(O)(=O)[C@H](C)NC(OC(C)(C)C)=O | | CAS DataBase Reference | 15761-38-3(CAS DataBase Reference) | | EPA Substance Registry System | L-Alanine, N-[(1,1-dimethylethoxy)carbonyl]- (15761-38-3) |
| Hazard Codes | Xi,Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2924 19 00 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | N-(tert-Butoxycarbonyl)-L-alanine Usage And Synthesis |
| Chemical Properties | White to off-white microcrystalline powder | | Uses | Boc-Ala-OH can be used:
- In the preparation of N-propargylalanine, a key precursor to generate N-(3-aryl)propylated alanine residues.
- In the resolution of racemic mixture of 3,3′-bis(benzyloxy)-1,1′-binaphthalene-2,2′-diol.
- In the one-pot synthesis of hybrid tripeptidomimetics containing both amide and imide functionalities.
| | reaction suitability | reaction type: Boc solid-phase peptide synthesis reaction type: C-H Activation reagent type: ligand reaction type: Peptide Synthesis |
| | N-(tert-Butoxycarbonyl)-L-alanine Preparation Products And Raw materials |
| Raw materials | 4-Mercaptophenol-->TERT-BUTYL 1,2,2,2-TETRACHLOROETHYL CARBONATE)-->BOC-ALA-OTBU-->BOC-L-ALANINE METHYL ESTER-->tert-Butanol-->L-Alanine-->tert-butyl azidoformate | | Preparation Products | CYCLO(-ALA-ALA)-->Carbamic acid, acetyl-, 1,1-dimethylethyl ester (9CI)-->(S)-4-Methyl-2,5-oxazolidonedione-->(S)-tert-Butyl 1-oxo-1-(2-(pyridin-2-yl)hydrazinyl)propan-2-ylcarbamate-->Carbamic acid, [2-[bis(phenylmethyl)amino]-1-methyl-2-oxoethyl]-, 1,1-dimethylethyl ester, (S)- (9CI)-->Carbamic acid, N-[(1S)-2-(3-methoxyphenyl)-1-methyl-2-oxoethyl]-, 1,1-dimethylethyl ester-->Carbamic acid, N-[(1S,2R)-2-hydroxy-2-(3-methoxyphenyl)-1-methylethyl]-, 1,1-dimethylethyl ester-->BOC-THIONOALA-1-(6-NITRO)BENZOTRIAZOLIDE-->Carbamic acid, N-[2-(methoxymethylamino)-1-methyl-2-oxoethyl]-, 1,1-dimethylethyl ester |
|