|
|
| | 4-(Trifluoroacetyl)benzoyl chloride Basic information |
| Product Name: | 4-(Trifluoroacetyl)benzoyl chloride | | Synonyms: | 4-(Trifluoroacetyl)benzoyl chloride;4-(Trifluoroacetyl)benzoyl chloride >=97.0% (GC);4-(TRIFLUOROACETYL)BENZOIC ACID CHLORIDE;4-(2,2,2-Trifluoroacetyl)benzoyl chloride;Benzoyl chloride, 4-(2,2,2-trifluoroacetyl)-;4-(2,2,2-trifluoroacetyl)benzoyl chloride - [T87033] | | CAS: | 58808-60-9 | | MF: | C9H4ClF3O2 | | MW: | 236.58 | | EINECS: | | | Product Categories: | | | Mol File: | 58808-60-9.mol |  |
| | 4-(Trifluoroacetyl)benzoyl chloride Chemical Properties |
| Fp | 120℃ | | form | liquid | | InChI | 1S/C9H4ClF3O2/c10-8(15)6-3-1-5(2-4-6)7(14)9(11,12)13/h1-4H | | InChIKey | RBOMQQAMVJDXBU-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(=O)c1ccc(cc1)C(Cl)=O |
| Hazard Codes | C | | Risk Statements | 34-36/37 | | Safety Statements | 26-27-28-36/37/39-45 | | RIDADR | UN 3265 8 / PGII | | WGK Germany | WGK 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B
STOT SE 3 |
| | 4-(Trifluoroacetyl)benzoyl chloride Usage And Synthesis |
| Uses | 4-(Trifluoroacetyl)benzoyl chloride is a fluorinated aromatic acyl chloride used as a building block in organic synthesis. It is primarily employed as a pharmaceutical intermediate in the preparation of fluorinated small-molecule drugs or aromatic amide-based drugs. | | Hazard | 4-(Trifluoroacetyl)benzoyl chloride is irritating and corrosive to the human body. Exposure may cause respiratory tract irritation, severe skin burns and eye damage. |
| | 4-(Trifluoroacetyl)benzoyl chloride Preparation Products And Raw materials |
|