|
|
| | ARG-PHE-ASP-SER Basic information |
| Product Name: | ARG-PHE-ASP-SER | | Synonyms: | H-ARG-PHE-ASP-SER-OH;ARG-PHE-ASP-SER;20: PN: US20040242483 SEQID: 6 unclaimed sequence;L-Arginyl-L-phenylalanyl-L-alpha-aspartyl-L-serine;RFDS;L-Serine,L-arginyl-L-phenylalanyl-L-a-aspartyl-;L-Serine, L-arginyl-L-phenylalanyl-L-α-aspartyl-;(6S,9S,12S,15S)-1,6-Diamino-9-benzyl-12-(carboxymethyl)-15-(hydroxymethyl)-1-imino-7,10,13-trioxo-2,8,11,14-tetraazahexadecan-16-oic acid | | CAS: | 102567-19-1 | | MF: | C22H33N7O8 | | MW: | 523.54 | | EINECS: | | | Product Categories: | Peptide;Cell Signaling Enzymes;ECM ProteinsCytoskeleton and Extracellular Matrix;Extracellular Matrix;Extracellular Matrix Peptides (ECM);Extracellular Matrix Peptides and ProteinsPeptides for Cell Biology;Fibronectin Fragments and Analogs;Matrix Metalloproteinases Products;Various Peptides | | Mol File: | 102567-19-1.mol |  |
| | ARG-PHE-ASP-SER Chemical Properties |
| density | 1.51±0.1 g/cm3(Predicted) | | storage temp. | -15°C | | form | Solid | | pka | 2.85±0.10(Predicted) | | Sequence | Arg-Phe-Asp-Ser | | InChIKey | SAGYNNXCQOFQHW-QDRDXGINNA-N | | SMILES | [C@@H](NC(=O)[C@@H](N)CCCNC(N)=N)(C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)O)CC1C=CC=CC=1 |&1:0,4,16,24,r| |
| | ARG-PHE-ASP-SER Usage And Synthesis |
| Uses | Arg-Phe-Asp-Ser is an inhibitor of T-lymphocyte proliferation. |
| | ARG-PHE-ASP-SER Preparation Products And Raw materials |
|