C19:1 (CIS-10) ACID manufacturers
|
| | C19:1 (CIS-10) ACID Basic information |
| | C19:1 (CIS-10) ACID Chemical Properties |
| Melting point | 11-12 °C | | Boiling point | 184-186 °C(Press: 0.5 Torr) | | density | 0.897±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml; Ethanol:PBS (pH7.2) (1:7): 0.25 mg/ml | | pka | 4.78±0.10(Predicted) | | form | liquid | | color | Colorless to light yellow | | biological source | synthetic (organic) | | InChI | 1S/C19H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h9-10H,2-8,11-18H2,1H3,(H,20,21)/b10-9- | | InChIKey | BBOWBNGUEWHNQZ-KTKRTIGZSA-N | | SMILES | CCCCCCCC\C=C/CCCCCCCCC(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | C19:1 (CIS-10) ACID Usage And Synthesis |
| Definition | ChEBI: (10Z)-nonadec-10-enoic acid is the (Z)-stereoisomer of 10-nonadecenoic acid. | | Biological Activity | Cis-10-Nonadecenoic acid is a long-chain fatty acid with antitumor activity. | | in vitro | Cis-10-Nonadecenoic acid is a kind of long-chain fatty acid with anti-tumor activity.It could also inhibit p53 activity. < /p> | | target | | Human Endogenous Metabolite < span> | |
| | C19:1 (CIS-10) ACID Preparation Products And Raw materials |
|