- BETAINE SALICYLATE
-
-
2025-12-01
- CAS:17671-53-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
- BETAINE SALICYLATE
-
- $6.00
-
2025-07-29
- CAS:17671-53-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 2000KG/Month
|
| Product Name: | BETAINE SALICYLATE | | Synonyms: | BETAINE SALICYLATE;carboxymethyl(trimethyl)azanium,2-carboxyphenolate;Betaine Salycilate | | CAS: | 17671-53-3 | | MF: | C12H17NO5 | | MW: | 255.26708 | | EINECS: | | | Product Categories: | | | Mol File: | 17671-53-3.mol |  |
| | BETAINE SALICYLATE Chemical Properties |
| Melting point | 107-109 °C | | Cosmetics Ingredients Functions | KERATOLYTIC ANTIMICROBIAL | | InChI | InChI=1S/C7H6O3.C5H11NO2/c8-6-4-2-1-3-5(6)7(9)10;1-6(2,3)4-5(7)8/h1-4,8H,(H,9,10);4H2,1-3H3 | | InChIKey | CFXSFDXXYYHZFU-UHFFFAOYSA-N | | SMILES | [O-]C(C[N+](C)(C)C)=O.C(O)(=O)C1=CC=CC=C1O |
| | BETAINE SALICYLATE Usage And Synthesis |
| Application | Betaine salicylate can effectively inhibit the growth of Gram-positive and Gram-negative bacteria and fungi, effectively kill the fungi that cause dandruff, and accelerate the shedding of the stratum corneum, thus removing dandruff. Its applicable formulations include creams, lotions, lotions, shampoos, and shower gels. | | Description | Betaine Salycilate is the product formed by the reaction of Betaine with Salycilic Acid |
| | BETAINE SALICYLATE Preparation Products And Raw materials |
|