| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:N,N-Di-Boc-2-iodoaniline
CAS:870703-53-0
Purity:97% Package:10G
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:N,N-Di-Boc-2-iodoaniline
CAS:870703-53-0
Purity:98% Remarks:B36128
|
| Company Name: |
Shanghai Carlow Chemicals Co., Ltd.
|
| Tel: |
21-33526724 18930996265 |
| Email: |
info@carlowchem.com |
| Products Intro: |
Product Name:1,3-Bis(1,1-dimethylethyl) 2-(2-iodophenyl)imidodicarbonate
CAS:870703-53-0
Purity:97% NMR Package:5g;25g
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:N,N-Di-Boc-2-iodoaniline
CAS:870703-53-0
Purity:97% Package:10G Remarks:644242-10G
|
N,N-DI-BOC-2-IODOANILINE manufacturers
|
| | N,N-DI-BOC-2-IODOANILINE Basic information |
| | N,N-DI-BOC-2-IODOANILINE Chemical Properties |
| Melting point | 109-113 °C (lit.) | | Boiling point | 403.8±47.0 °C(Predicted) | | density | 1.452±0.06 g/cm3(Predicted) | | pka | -1.46±0.50(Predicted) | | form | solid | | InChI | 1S/C16H22INO4/c1-15(2,3)21-13(19)18(14(20)22-16(4,5)6)12-10-8-7-9-11(12)17/h7-10H,1-6H3 | | InChIKey | OLSDDNDJGXNWIZ-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1ccccc1I |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | N,N-DI-BOC-2-IODOANILINE Usage And Synthesis |
| | N,N-DI-BOC-2-IODOANILINE Preparation Products And Raw materials |
|