| Company Name: |
Syntechem Co.,Ltd
|
| Tel: |
|
| Email: |
info@syntechem.com |
| Products Intro: |
Product Name:2-((ethoxyMethyl)(2-ethyl-6-Methylphenyl)aMino)-2-oxoacetic acid CAS:194992-44-4 Purity:97% Package:1g;5g;25g;100g;250g;1kg;5kg;10kg;25kg Remarks:we offer low price custom synthesis and contract manufacturing
|
| Company Name: |
Shanghai BeiZhuo Biotech Co., Ltd.
|
| Tel: |
021-61119791,13386096464 |
| Email: |
bzswkf@foxmail.com |
| Products Intro: |
Product Name:Acetochlor OA, Pestanal CAS:194992-44-4 Purity:99%HPLC Package:10MG
|
|
| | Acetochlor OA, Pestanal Basic information |
| Product Name: | Acetochlor OA, Pestanal | | Synonyms: | Acetochlor OA, Pestanal;ACETOCHLOR OA;n-(ethoxymethyl)-n-(2-ethyl-6-methylphenyl)oxalamic acid;N-(Ethoxymethyl)-N-(2-ethyl-6-methylphenyl)oxalamic acid, [(Ethoxymethyl)(2-ethyl-6-methylphenyl)amino]oxo-acetic acid;[(Ethoxymethyl)(2-ethyl-6-methylphenyl)amino]oxo-acetic acid, N-(Ethoxymethyl)-N-(2-ethyl-6-methylphenyl)oxalamic acid;Acetochlor oxalamic acid (OA);2-((ethoxyMethyl)(2-ethyl-6-Methylphenyl)aMino)-2-oxoacetic acid;Acetochlor Impurity 1 | | CAS: | 194992-44-4 | | MF: | C14H19NO4 | | MW: | 265.3 | | EINECS: | | | Product Categories: | | | Mol File: | 194992-44-4.mol |  |
| | Acetochlor OA, Pestanal Chemical Properties |
| Boiling point | 396.4±52.0 °C(Predicted) | | density | 1.183±0.06 g/cm3(Predicted) | | pka | -0.05±0.54(Predicted) | | Major Application | agriculture environmental | | InChI | 1S/C14H19NO4/c1-4-11-8-6-7-10(3)12(11)15(9-19-5-2)13(16)14(17)18/h6-8H,4-5,9H2,1-3H3,(H,17,18) | | InChIKey | OTKTUNJJKYTOFF-UHFFFAOYSA-N | | SMILES | CCOCN(C(=O)C(O)=O)c1c(C)cccc1CC | | EPA Substance Registry System | Acetic acid, 2-[(ethoxymethyl)(2-ethyl-6-methylphenyl)amino]-2-oxo- (194992-44-4) |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Acetochlor OA, Pestanal Usage And Synthesis |
| Uses | Acetochlor OA is a metabolite of Acetochlor (A162500), which is a chloroacetanilide related herbicide that inhibits elongase and geranylgeranyl pyrophosphate (GGPP) cyclization enzymes. Drinking water contaminant candidate list 3 (CCL 3) compound as per United States Environmental Protection Agency (EPA), environmental, and food contaminants. | | Definition | ChEBI: Acetochlor OXA is a monocarboxylic acid that is oxoacetic acid substituted by a (ethoxymethyl)(2-ethyl-6-methylphenyl)amino group at position 2. It is a metabolite of acetochlor. It has a role as a marine xenobiotic metabolite. It is an aromatic amide, an ether and a monocarboxylic acid. |
| | Acetochlor OA, Pestanal Preparation Products And Raw materials |
|