| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:(+)-3-Bromocamphor-10-sulfonic acid hydrate CAS:206860-46-0 Remarks:RA10470148
|
(+)-3-BROMOCAMPHOR-10-SULFONIC ACID HYDR manufacturers
|
| | (+)-3-BROMOCAMPHOR-10-SULFONIC ACID HYDR Basic information |
| | (+)-3-BROMOCAMPHOR-10-SULFONIC ACID HYDR Chemical Properties |
| Melting point | 118-120 °C | | storage temp. | 2-8°C | | Optical Rotation | [α]20/D +94°, c = 1 in H2O | | InChI | 1S/C10H15BrO4S.H2O/c1-9(2)6-3-4-10(9,5-16(13,14)15)8(12)7(6)11;/h6-7H,3-5H2,1-2H3,(H,13,14,15);1H2/t6-,7+,10-;/m1./s1 | | InChIKey | RQZLIPHNDCFLPR-OFVIFIGMSA-N | | SMILES | O.CC1(C)[C@@H]2CC[C@@]1(CS(O)(=O)=O)C(=O)[C@H]2Br |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN3261 8/PG 2 | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | (+)-3-BROMOCAMPHOR-10-SULFONIC ACID HYDR Usage And Synthesis |
| | (+)-3-BROMOCAMPHOR-10-SULFONIC ACID HYDR Preparation Products And Raw materials |
|