To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 16051-77-7 |
| SMILES: | O=[N+](O[C@@H]1CO[C@H]2C(CO[C@@H]12)=O)[O-] |
| Formula: | C6H9NO6 |
| M.Wt: | 191.14 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Isosorbide mononitrate(Isosorbide-5-mononitrate) is a nitrate-class compound used for angina pectoris; acts by dilating the blood vessels so as to reduce the blood pressure. |
