5-Ethynylisophthalic acid
|
|
|
- CAS-Nr.
- 432025-97-3
- Englisch Name:
- 5-Ethynylisophthalic acid
- Synonyma:
- DK7429;5-Ethynylisophthalic acid;5-ETHYNYLBENZENE-1,3-DIOIC ACID;5-yneylorthobenzenedimacetic acid;5-Ethynyl-1,3-benzenedicarboxylic acid;1,3-Benzenedicarboxylic acid, 5-ethynyl-
- CBNumber:
- CB72755774
- Summenformel:
- C10H6O4
- Molgewicht:
- 190.15
- MOL-Datei:
- 432025-97-3.mol
|
5-Ethynylisophthalic acid Eigenschaften
- Schmelzpunkt:
- 245-255°C
- Siedepunkt:
- 450.7±40.0 °C(Predicted)
- Dichte
- 1.47±0.1 g/cm3(Predicted)
- storage temp.
- under inert gas (nitrogen or Argon) at 2-8°C
- Aggregatzustand
- solid
- pka
- 3.32±0.10(Predicted)
- Aussehen
- White to off-white Solid
- InChI
- 1S/C10H6O4/c1-2-6-3-7(9(11)12)5-8(4-6)10(13)14/h1,3-5H,(H,11,12)(H,13,14)
- InChIKey
- XKEUZQRIANAGPB-UHFFFAOYSA-N
- SMILES
- OC(=O)c1cc(cc(c1)C(O)=O)C#C
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
Xn |
|
|
| R-S?tze: |
22-36/37/38 |
|
|
| S-S?tze: |
26 |
|
|
| WGK Germany |
3 |
|
|
| HS Code |
2917399590 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Hazard Classifications |
Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
 |
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
 |
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
5-Ethynylisophthalic acid Chemische Eigenschaften,Einsatz,Produktion Methoden
Verwenden
MOF linker used for the synthesis of MOFs with pores which can be further functionalized by click chemistry
Allgemeine Beschreibung
This product has been enhanced for energy efficiency.
5-Ethynylisophthalic acid Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
5-Ethynylisophthalic acid Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 61)Lieferanten
432025-97-3()Verwandte Suche:
- 5-Ethynyl-1,3-benzenedicarboxylic acid
- 5-Ethynylisophthalic acid
- 5-ETHYNYLBENZENE-1,3-DIOIC ACID
- 1,3-Benzenedicarboxylic acid, 5-ethynyl-
- DK7429
- 5-yneylorthobenzenedimacetic acid
- 432025-97-3
- 432028-97-3