|
|
| | (S)-1,2,3,4-tetrahydro-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-methylisoquinolin-7-ol Basic information |
| Product Name: | (S)-1,2,3,4-tetrahydro-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-methylisoquinolin-7-ol | | Synonyms: | (S)-1,2,3,4-tetrahydro-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-methylisoquinolin-7-ol;(1S)-1-[(3-hydroxy-4-methoxy-phenyl)methyl]-6-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-7-ol;[1S,(+)]-1,2,3,4-Tetrahydro-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-methylisoquinolin-7-ol;[1S,(+)]-1,2,3,4-Tetrahydro-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-methylisoquinoline-7-ol;2-Methoxy-5-[[(1S)-2-methyl-6-methoxy-7-hydroxy-1,2,3,4-tetrahydroisoquinoline]-1-ylmethyl]phenol;Reticuline (>90% ee);7-Isoquinolinol, 1,2,3,4-tetrahydro-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-methyl-, (1S)-;(S)-1-(3-hydroxy-4-methoxybenzyl)-6-methoxy-2-methyl-1,2,3,4-tetrahydroisoquinolin-7-ol | | CAS: | 485-19-8 | | MF: | C19H23NO4 | | MW: | 329.39 | | EINECS: | 207-611-3 | | Product Categories: | Amines;Aromatics;Chiral Reagents;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 485-19-8.mol | ![(S)-1,2,3,4-tetrahydro-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-methylisoquinolin-7-ol Structure](CAS/GIF/485-19-8.gif) |
| | (S)-1,2,3,4-tetrahydro-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-methylisoquinolin-7-ol Chemical Properties |
| Melting point | 125-126°C | | Boiling point | 648.96°C (rough estimate) | | density | 1.4371 (rough estimate) | | refractive index | 1.6800 (estimate) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in DMSO | | form | Solid | | pka | 9.95±0.10(Predicted) | | color | Off-white to yellow | | Optical Rotation | +88.318 (c 0.21, ethanol) | | InChI | InChI=1S/C19H23NO4/c1-20-7-6-13-10-19(24-3)17(22)11-14(13)15(20)8-12-4-5-18(23-2)16(21)9-12/h4-5,9-11,15,21-22H,6-8H2,1-3H3/t15-/m0/s1 | | InChIKey | BHLYRWXGMIUIHG-HNNXBMFYSA-N | | SMILES | [C@H]1(CC2=CC=C(OC)C(O)=C2)C2=C(C=C(OC)C(O)=C2)CCN1C |
| | (S)-1,2,3,4-tetrahydro-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-methylisoquinolin-7-ol Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | Precursor of many aporphine and morphine-type alkaloids. | | Uses | Reticulin can be used to improve production of morphinan alkaloids, as well as its anti-inflammatory properties. It can also be used to lead scaffolds as PDE5A inhibitors and antihypertensives. | | Definition | ChEBI: The (S)-enantiomer of reticuline. | | in vivo | Reticuline (5, 10 and 20 mg/kg, i. v., randomly) injections produced an intense hypotension in normotensive rats. The hypotensive effect of Reticuline is probably due to a peripheral vasodilation in consequence of: 1) muscarinic stimulation and NOS activation in the vascular endothelium, 2) voltage-dependent Ca2+ channel blockade and/or 3) inhibition of Ca2+ release from norepinephrine-sensitive intracellular stores[2]. | | IC 50 | JAK2; STAT3; NF-κB; Human Endogenous Metabolite |
| | (S)-1,2,3,4-tetrahydro-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-methylisoquinolin-7-ol Preparation Products And Raw materials |
|