|
|
| | 2-(TERT-BUTYL)ANTHRACENE Basic information |
| | 2-(TERT-BUTYL)ANTHRACENE Chemical Properties |
| Melting point | 146-148 °C(lit.) | | Boiling point | 406.66°C (estimate) | | density | 1.0157 (estimate) | | refractive index | 1.6855 (estimate) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C18H18/c1-18(2,3)17-9-8-15-10-13-6-4-5-7-14(13)11-16(15)12-17/h4-12H,1-3H3 | | InChIKey | WBPXZSIKOVBSAS-UHFFFAOYSA-N | | SMILES | C1=C2C(C=C3C(=C2)C=CC=C3)=CC=C1C(C)(C)C | | CAS DataBase Reference | 18801-00-8 | | EPA Substance Registry System | 2-tert-Butylanthracene (18801-00-8) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29029000 |
| | 2-(TERT-BUTYL)ANTHRACENE Usage And Synthesis |
| Chemical Properties | LIGHT YELLOW POWDER |
| | 2-(TERT-BUTYL)ANTHRACENE Preparation Products And Raw materials |
|