- TBADN
-
- $3.00
-
2026-04-17
- CAS:274905-73-6
- Purity: 99%
|
| | 2-TERTBUTYL-9,10-DI(2-NAPHTHYL)ANTHRACENE Basic information |
| | 2-TERTBUTYL-9,10-DI(2-NAPHTHYL)ANTHRACENE Chemical Properties |
| Boiling point | 624.8±50.0 °C(Predicted) | | density | 1.150±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | InChI | 1S/C38H30/c1-38(2,3)31-20-21-34-35(24-31)37(30-19-17-26-11-5-7-13-28(26)23-30)33-15-9-8-14-32(33)36(34)29-18-16-25-10-4-6-12-27(25)22-29/h4-24H,1-3H3 | | InChIKey | OBAJPWYDYFEBTF-UHFFFAOYSA-N | | SMILES | CC(C)(C)C1=CC2=C(C3=CC=C(C=CC=C4)C4=C3)C5=CC=CC=C5C(C6=CC=C(C=CC=C7)C7=C6)=C2C=C1 |
| Risk Statements | 53 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | 2-TERTBUTYL-9,10-DI(2-NAPHTHYL)ANTHRACENE Usage And Synthesis |
| Uses | 2-tert-Butyl-9,10-di(naphth-2-yl)anthracene (TBADN) is used as a blue light-emitting material in organic light-emitting diode (OLED) [1] |
| | 2-TERTBUTYL-9,10-DI(2-NAPHTHYL)ANTHRACENE Preparation Products And Raw materials |
|