- PELARGONIN CHLORIDE
-
- $1.00
-
2019-07-06
- CAS:17334-58-6
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 100KG
|
| | PELARGONIN CHLORIDE Basic information |
| Product Name: | PELARGONIN CHLORIDE | | Synonyms: | SALVININ;PELARGONIDIN-3,5-DIGLUCOSIDE CHLORIDE;PELARGONIDIN-3,5-DIGLUCOSIDE HYDROCHLORIDE;PELARGONIDIN 3,5-DI-O-GLUCOSIDE CHLORIDE;PELARGONIN CHLORIDE;MONARDIN;3,5-BIS(GLUCOSYLOXY)-4',7-DIHYDROXYFLAVYLIUM CHLORIDE;3,5-bis(beta-D-glucopyranosyloxy)-7-hydroxy-2-(4-hydroxyphenyl)-1-benzopyrylium chloride | | CAS: | 17334-58-6 | | MF: | C27H31ClO15 | | MW: | 630.98 | | EINECS: | 241-360-0 | | Product Categories: | Anthocyanins | | Mol File: | 17334-58-6.mol |  |
| | PELARGONIN CHLORIDE Chemical Properties |
| alpha | D -291° | | storage temp. | −20°C | | solubility | Soluble in methan | | form | powder | | color | Dark, reddish | | biological source | synthetic | | InChIKey | DIRROHKULXIUCB-DHJOXOLYSA-N | | SMILES | [Cl-].OC[C@H]1O[C@@H](Oc2cc3c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc(O)cc3[o+]c2-c5ccc(O)cc5)[C@H](O)[C@@H](O)[C@@H]1O | | CAS DataBase Reference | 17334-58-6 |
| WGK Germany | 3 | | F | 10 | | Storage Class | 11 - Combustible Solids |
| | PELARGONIN CHLORIDE Usage And Synthesis |
| Uses | Pelargonin is one of anthocyanins that possess potent antioxidant properties. | | Biological Activity | Pelargonin is an anthocyanin, which are present in fruits and vegetables as natural colorants. It was found in dates and investigated for anti-allergic properties. It shows some oxygen radical absorbance capacity ', 'The phytoestrogen pelargonin, also known as pelargonidin, is a common anthocyanin which displays antioxidant and antigenotoxic properties. |
| | PELARGONIN CHLORIDE Preparation Products And Raw materials |
|