| Company Name: |
Sichuan Wei Keqi Biological Technology Co., Ltd.
|
| Tel: |
028-81700200 18116577057 |
| Email: |
3003855609@qq.com |
| Products Intro: |
Product Name:Peonidin 3,5-diglucoside chloride
CAS:132-37-6
Purity:HPLC>=98% Package:5mg;10mg;20mg;50mg;100mg;200mg;500mg;1g
|
| Company Name: |
Wuxi Zhongkun Biochemical Technology Co., Ltd.
|
| Tel: |
0510-85629785 18013409632 |
| Email: |
sales@reading-chemicals.com |
| Products Intro: |
Product Name:Peonidin 3,5-diglucoside chloride
CAS:132-37-6
Purity:95%+ Package:根據(jù)客戶需求包裝
|
|
| | PEONIN CHLORIDE(SH) Basic information |
| Product Name: | PEONIN CHLORIDE(SH) | | Synonyms: | PEONIN CHLORIDE(SH);3,5-bis(beta-D-glucopyranosyloxy)-7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-benzopyrylium chloride;PEONIDIN-3,5-DIGLUCOSIDE CHLORIDE hplc;(2S,3R,4S,5S,6R)-2-[[7-hydroxy-2-(4-hydroxy-3-methoxy-phenyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methylol-tetrahydropyran-2-yl]oxy-1-benzopyrylium-3-yl]oxy]-6-methylol-tetrahydropyran-3,4,5-triol chloride;(2S,3R,4S,5S,6R)-2-[7-hydroxy-2-(4-hydroxy-3-methoxy-phenyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-chromenylium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol chloride;(2S,3R,4S,5S,6R)-2-[7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol chloride;PEONIDIN-3-O-ARABINOSIDE CHLORIDE(SH)(NEW);Peonidin 3,5-di-O-β-glucopyranosidechloride | | CAS: | 132-37-6 | | MF: | C28H33ClO16 | | MW: | 661.00502 | | EINECS: | 205-060-3 | | Product Categories: | Anthocyanins | | Mol File: | 132-37-6.mol |  |
| | PEONIN CHLORIDE(SH) Chemical Properties |
| storage temp. | -20°C | | form | Solid | | color | Brown to black | | Major Application | food and beverages | | InChIKey | NLSMPWTZYGSAEU-CYUNEVMDSA-N | | SMILES | [Cl-].[o+]1c2c(c(cc(c2)O)O[C@@H]5O[C@@H]([C@H]([C@@H]([C@H]5O)O)O)CO)cc(c1c4cc(c(cc4)O)OC)O[C@@H]3O[C@@H]([C@H]([C@@H]([C@H]3O)O)O)CO |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | PEONIN CHLORIDE(SH) Usage And Synthesis |
| Description | Paeonin is a monoterpene derivative from the roots of Paeonia lactiflora that has antiproliferative effects. | | Uses | Peonidin 3,5-diglucoside is a classic anthocyanin isolated from violet flowers[1]. | | References | [1] De Loose R. The flower pigments of the belgian hybrids of Rhododendron simsii and other species and varieties from Rhododendron subseries obtusum. Phytochemistry. Volume 8, Issue 1, January 1969, Pages 253-259. |
| | PEONIN CHLORIDE(SH) Preparation Products And Raw materials |
|