|
|
| | 2,4-DIMETHYL-6-HYDROXYPYRIMIDINE Basic information |
| Product Name: | 2,4-DIMETHYL-6-HYDROXYPYRIMIDINE | | Synonyms: | 4-Hydroxy-2,6-dimethylpyrimidine, >=99%;4(1H)-Pyrimidinone, 2,6-dimethyl- (8CI,9CI);2,4-Dimethyl-6-hydroxypyrimidine, 99+%;6-HYDROXY-2,4-DIMETHYLPYRIMIDINE;2,4-DIMETHYL-6-HYDROXYPYRIMIDINE;2,6-DIMETHYL-4-PYRIMIDINO;2,6-DIMETHYL-4-PYRIMIDINOL;2,6-DIMETHYL-4-HYDROXYPYRIMIDINE | | CAS: | 6622-92-0 | | MF: | C6H8N2O | | MW: | 124.14 | | EINECS: | 229-577-9 | | Product Categories: | alcohol;PYRIMIDINE;APIs & Intermediate | | Mol File: | 6622-92-0.mol |  |
| | 2,4-DIMETHYL-6-HYDROXYPYRIMIDINE Chemical Properties |
| Melting point | 198.5-200 °C (lit.) | | Boiling point | 230.92°C (rough estimate) | | density | 1.1683 (rough estimate) | | refractive index | 1.5378 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 9.87±0.50(Predicted) | | form | Crystalline Needles | | color | White | | BRN | 114324 | | InChI | InChI=1S/C6H8N2O/c1-4-3-6(9)8-5(2)7-4/h3H,1-2H3,(H,7,8,9) | | InChIKey | UQFHLJKWYIJISA-UHFFFAOYSA-N | | SMILES | C1(C)=NC(C)=CC(=O)N1 | | CAS DataBase Reference | 6622-92-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29335995 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,4-DIMETHYL-6-HYDROXYPYRIMIDINE Usage And Synthesis |
| Chemical Properties | white crystalline needles | | Synthesis | General procedure for the synthesis of 2,4-dimethyl-6-hydroxypyrimidines from acetamidine hydrochloride and ethyl acetoacetate: to a solution of sodium ethanolate (10.5 g, 154 mmol) in ethanol (200 mL) was added ethyl 3-oxobutanoate (10.0 g, 77 mmol) and acetamidine hydrochloride (7.23 g, 77 mmol) sequentially. The reaction mixture was heated to reflux for 20 hours. After completion of the reaction, water (10 mL) was added to the mixture. The reaction mixture was concentrated under reduced pressure to give the crude product. The crude product was purified by column chromatography (silica gel as stationary phase, dichloromethane/methanol=15:1 as mobile phase) to afford 2,6-dimethylpyrimidin-4-ol as a yellow solid (3.43 g, 36% yield).LRMS (M+H+) m/z: Calculated value 124.06; measured value 124. | | References | [1] Patent: WO2013/75083, 2013, A1. Location in patent: Paragraph 00374; 00375
[2] Synthesis (Germany), 2016, vol. 48, # 23, p. 4246 - 4252
[3] Patent: US2012/95031, 2012, A1. Location in patent: Page/Page column 159-160 |
| | 2,4-DIMETHYL-6-HYDROXYPYRIMIDINE Preparation Products And Raw materials |
|