| Company Name: |
Shenzhen Roark Pharma-Tec Co., Ltd. Gold
|
| Tel: |
13128912434 |
| Email: |
2880126944@qq.com |
| Products Intro: |
Product Name:Peramivir Impurity 6 CAS:2124296-37-1 Purity:98% HPLC Package:10MG;25MG;50MG;100MG
|
|
| | Peramivir Impurity 6 Basic information |
| Product Name: | Peramivir Impurity 6 | | Synonyms: | Peramivir Impurity 6;(1S,2S,3R,4R)-3-((R)-1-acetamido-2-ethylbutyl)-4-guanidino-2-hydroxycyclopentane-1-carboxylic acid;Cyclopentanecarboxylic acid, 3-[(1R)-1-(acetylamino)-2-ethylbutyl]-4-[(aminoiminomethyl)amino]-2-hydroxy-, (1S,2S,3R,4R)-rel-;Peramivir impurities10;rel-(1S,2S,3R,4R)-3-[(1R)-1-(Acetylamino)-2-ethylbutyl]-4-[(aminoiminomethyl)amino]-2-hydroxycyclopentanecarboxylic acid;(1S,2S,3R,4R)-3-((R)-1-acetamido-2-ethylbutyl)-4-guanidino-2-hydroxycyclopentanecarboxylic acid | | CAS: | 2124296-37-1 | | MF: | C15H28N4O4 | | MW: | 328.41 | | EINECS: | | | Product Categories: | | | Mol File: | 2124296-37-1.mol |  |
| | Peramivir Impurity 6 Chemical Properties |
| density | 1.39±0.1 g/cm3(Predicted) | | pka | 4.08±0.70(Predicted) | | InChI | InChI=1/C15H28N4O4/c1-4-8(5-2)12(18-7(3)20)11-10(19-15(16)17)6-9(13(11)21)14(22)23/h8-13,21H,4-6H2,1-3H3,(H,18,20)(H,22,23)(H4,16,17,19)/t9-,10+,11+,12+,13+/s3 | | InChIKey | XRQDFNLINLXZLB-KHVMVRHBNA-N | | SMILES | [C@H]1(C(O)=O)C[C@@H](NC(N)=N)[C@H]([C@H](NC(C)=O)C(CC)CC)[C@@H]1O |&1:0,5,10,11,21,r| |
| | Peramivir Impurity 6 Usage And Synthesis |
| | Peramivir Impurity 6 Preparation Products And Raw materials |
|