- BOC-TRP(BOC)-OH
-
-
2025-04-04
- CAS:144599-95-1
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
- BOC-TRP(BOC)-OH
-
- $1.00
-
2020-01-10
- CAS:144599-95-1
- Min. Order: 1KG
- Purity: 98% HPLC
- Supply Ability: 10 tons/month
|
| | BOC-TRP(BOC)-OH Basic information |
| | BOC-TRP(BOC)-OH Chemical Properties |
| density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | Soluble in dimethylformamide (1 mmole in 2 ml). | | pka | 3.82±0.10(Predicted) | | form | powder | | Appearance | White to light yellow Solid | | Optical Rotation | -9.7°(C=0.01 g/ml DMF) | | Major Application | peptide synthesis | | InChI | 1S/C21H28N2O6/c1-20(2,3)28-18(26)22-15(17(24)25)11-13-12-23(19(27)29-21(4,5)6)16-10-8-7-9-14(13)16/h7-10,12,15H,11H2,1-6H3,(H,22,26)(H,24,25)/t15-/m0/s1 | | InChIKey | FATGZMFSCKUQGO-HNNXBMFYSA-N | | SMILES | [n]1(c2c(c(c1)C[C@H](NC(=O)OC(C)(C)C)C(=O)O)cccc2)C(=O)OC(C)(C)C |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | BOC-TRP(BOC)-OH Usage And Synthesis |
| Uses | N-Boc-1-Boc-L-tryptophan is generally used as a intermediate in pharmaceutical and chemical research. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-TRP(BOC)-OH Preparation Products And Raw materials |
|