|
|
| | KERACYANIN CHLORIDE Basic information |
| Product Name: | KERACYANIN CHLORIDE | | Synonyms: | antirrhinin;prunicyanin;rutinosyl-3-cyanidine;CYANIDIN-BETA-D-RHAMNOSIDE CHLORIDE;CYANIDIN RHAMNOGLUCOSIDE;CYANIDIN 3-O-RHAMNOGLUCOSIDE CHLORIDE;CYANIDIN-3-RUTINOSIDE CHLORIDE;KERACYANIN CHLORIDE | | CAS: | 18719-76-1 | | MF: | C27H31ClO15 | | MW: | 630.98 | | EINECS: | 242-528-6 | | Product Categories: | Anthocyanins | | Mol File: | 18719-76-1.mol |  |
| | KERACYANIN CHLORIDE Chemical Properties |
| Melting point | 175℃ | | storage temp. | −20°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | Red to Dark Red | | Major Application | food and beverages | | InChIKey | ADZHXBNWNZIHIX-XYGAWYNKSA-N | | SMILES | [Cl-].C[C@@H]1O[C@@H](OC[C@H]2O[C@@H](Oc3cc4c(O)cc(O)cc4[o+]c3-c5ccc(O)c(O)c5)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| WGK Germany | 3 | | RTECS | OA5007000 | | F | 10 | | Storage Class | 11 - Combustible Solids |
| | KERACYANIN CHLORIDE Usage And Synthesis |
| Uses | Cyanidin 3-O-Rutinoside retards absorption of carbohydrates by inhibition of α-glucosidase which may be useful as a potential inhibitor for prevention and treatment of diabetes mellitus. | | Definition | KERACYANIN CHLORIDE is a member of the class of anthocyanin chlorides that has cyanidin 3-O-rutinoside as the cationic counterpart. | | target | COX |
| | KERACYANIN CHLORIDE Preparation Products And Raw materials |
|