|
|
| | N-Boc-N,N-bis(2-bromoethyl)amine Basic information |
| Product Name: | N-Boc-N,N-bis(2-bromoethyl)amine | | Synonyms: | N-Boc-N,N-bis(2-bromoethyl)amine;N-Boc-N,N-bis(2-broMoethy...;CarbaMic acid,bis(2-broMoethyl)-, 1,1-diMethylethyl ester (9CI);Carbamic acid, N,N-bis(2-bromoethyl)-, 1,1-dimethylethyl ester;N-Boc-N,N-bis(2-bromoethyl)amine - [B11889];tert-Butyl bis(2-broMoethyl)carbaMate;tert-butyl N,N-bis(2-bromoethyl)carbamate | | CAS: | 159635-50-4 | | MF: | C9H17Br2NO2 | | MW: | 331.04 | | EINECS: | | | Product Categories: | | | Mol File: | 159635-50-4.mol |  |
| | N-Boc-N,N-bis(2-bromoethyl)amine Chemical Properties |
| Boiling point | 317.7±35.0 °C(Predicted) | | density | 1.545±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | -1.80±0.70(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H17Br2NO2/c1-9(2,3)14-8(13)12(6-4-10)7-5-11/h4-7H2,1-3H3 | | InChIKey | CIKNCWSDHQVBKL-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)N(CCBr)CCBr |
| | N-Boc-N,N-bis(2-bromoethyl)amine Usage And Synthesis |
| | N-Boc-N,N-bis(2-bromoethyl)amine Preparation Products And Raw materials |
|