- S-ATBA
-
- $50.00
-
2025-05-23
- CAS:109010-60-8
- Min. Order: 1kg
- Purity: 99
- Supply Ability: 5000
- S-ATBA
-
- $7.00
-
2019-07-06
- CAS: 109010-60-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| Product Name: | S-ATBA | | Synonyms: | {(3s)-3-[(1s)-1-ethoxycarbonyl-3-phenylpropylamino]-2,3,4,5-tetrahydro-2-oxo-1h-1-benzazepin-1-yl}acetic acid hydrochloride;tert-Butyl (S)-2-(3-Amino-2-oxo-2,3,4,5-tetrahydrobenzo[b]azepin-1-yl)acetate;tert-Butyl (S)-2-(3-AMino-2-oxo-2,3,4,5-tetrahydrobenzo[b]azepin;tert-butyl 2-[(3S)-3-aMino-2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl]acetate;(3S)-1H-1-Benzazepine-1-acetic Acid 3-AMino-2,3,4,5-tetrahydro-2-oxo-1,1-diMethylethyl Ester;1H-1-Benzazepine-1-acetic acid, 3-aMino-2,3,4,5-tetrahydro-2-oxo-, 1,1-diMethylethyl ester, (3S)-;3-(S)-AMINO-1-T-BUTOXY CAROBNYLMETHYL-2,3,4,5-TETRAHYDRO-1H(1)-BENZAZEPIN-2-ONE TARTARATE SALT;(S)-3-Amino-2,3,4,5-Tetrahydro-2-Oxo-1H-1-Benzazepine-1-AcetaticAcid-1,2-DimethylethylEster | | CAS: | 109010-60-8 | | MF: | C16H22N2O3 | | MW: | 290.36 | | EINECS: | 1806241-263-5 | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 109010-60-8.mol |  |
| | S-ATBA Chemical Properties |
| Melting point | 115-116°C | | alpha | -270 º (c=0.5, EtOH) | | Boiling point | 483.2±45.0 °C(Predicted) | | density | 1.133±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | DMSO: ~34 mg/mL, soluble | | form | solid | | pka | 7.37±0.20(Predicted) | | color | white | | Optical Rotation | Consistent with structure | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C16H22N2O3/c1-16(2,3)21-14(19)10-18-13-7-5-4-6-11(13)8-9-12(17)15(18)20/h4-7,12H,8-10,17H2,1-3H3/t12-/m0/s1 | | InChIKey | QTEDVVHLTMELTB-LBPRGKRZSA-N | | SMILES | N1(CC(OC(C)(C)C)=O)C2=CC=CC=C2CC[C@H](N)C1=O | | CAS DataBase Reference | 109010-60-8(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 2 | | RTECS | CX7065000 | | HS Code | 2933790002 | | Storage Class | 11 - Combustible Solids |
| | S-ATBA Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | S-ATBA is an intermediate in the synthesis of benazepril. | | Application | S-ATBA can be used in the manufacture of the novel antihypertensive drug angiotensin-converting enzyme inhibitor (ACE-I) benazepril. |
| | S-ATBA Preparation Products And Raw materials |
|