- 3-Nitropropiophenone
-
- $1.00
-
2020-01-05
- CAS:17408-16-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kg
|
| | 3-Nitropropiophenone Basic information |
| | 3-Nitropropiophenone Chemical Properties |
| Melting point | 98-101 °C (lit.) | | Boiling point | 254.5±13.0 °C(Predicted) | | density | 1.199±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Yellow to Green | | BRN | 1954069 | | InChI | 1S/C9H9NO3/c1-2-9(11)7-4-3-5-8(6-7)10(12)13/h3-6H,2H2,1H3 | | InChIKey | VSPOTMOYDHRALZ-UHFFFAOYSA-N | | SMILES | CCC(=O)c1cccc(c1)[N+]([O-])=O | | CAS DataBase Reference | 17408-16-1(CAS DataBase Reference) | | NIST Chemistry Reference | m-Nitropropiophenone(17408-16-1) |
| | 3-Nitropropiophenone Usage And Synthesis |
| Uses | 3′-Nitropropiophenone was used to study the FTIR and FT Raman spectra in the regions 3500-100 cm(-1). |
| | 3-Nitropropiophenone Preparation Products And Raw materials |
|