- Talampanel
-
- $49.00
-
2026-05-11
- CAS:161832-65-1
- Purity: 98.30%
- Supply Ability: 10g
- Talampanel
-
-
2025-04-04
- CAS:161832-65-1
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1Ton
|
| | Talampanel Basic information |
| Product Name: | Talampanel | | Synonyms: | Talampanel;(8R)-7-Acetyl-5-(4-aminophenyl)-8,9-dihydro-8-methyl-7H-1,3-dioxolo[4,5-h][2,3]benzodiazepine;C13670;GYKI 53773;LY 300164;TalaMpanel(LY300164);(8R)-7-Acetyl-5-(4-aminophenyl)-8,9-dihydro-8-methyl-7H-1,3-dioxolo[4,5-h][2,3]benzodiazepine Talampanel(LY300164);Talampanel
(8R)-7-Acetyl-5-(4-aminophenyl)-8,9-dihydro-8-methyl-7H-1,3-dioxolo[4,5-h][2,3]benzodiazepine | | CAS: | 161832-65-1 | | MF: | C19H19N3O3 | | MW: | 337.37 | | EINECS: | | | Product Categories: | | | Mol File: | 161832-65-1.mol |  |
| | Talampanel Chemical Properties |
| Melting point | 169-172° | | alpha | D -321.34° (c = 1 in methanol) | | Boiling point | 528.9±60.0 °C(Predicted) | | density | 1.37±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: soluble15mg/mL, clear | | form | powder | | pka | 4.67±0.10(Predicted) | | color | white to beige | | Optical Rotation | [α]/D -280 to -340°, c = 1 in methanol | | InChI | 1S/C19H19N3O3/c1-11-7-14-8-17-18(25-10-24-17)9-16(14)19(21-22(11)12(2)23)13-3-5-15(20)6-4-13/h3-6,8-9,11H,7,10,20H2,1-2H3/t11-/m1/s1 | | InChIKey | JACAAXNEHGBPOQ-LLVKDONJSA-N | | SMILES | C[C@H](C1)N(C(C)=O)N=C(C2=CC=C(N)C=C2)C3=C1C=C(OCO4)C4=C3 |
| Hazard Codes | T,N | | Risk Statements | 25-50/53 | | Safety Statements | 45-60-61 | | RIDADR | UN2811 - class 6.1 - PG 3 - EHS - Toxic solids, organic, n.o.s., HI: all | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Acute 1
Aquatic Chronic 1 |
| | Talampanel Usage And Synthesis |
| Uses | Talampanel is a potent and selective AMPA antagonist and is also used as an antiepileptic drug. | | Definition | ChEBI: Talampanel is a member of benzodioxoles. | | Biological Activity | Talampanel ia a specific noncompetitive AMPA receptor antagonist and anticonvulsant. | | in vivo | Talampanel (orally administration; 5 mg/kg; once a day; 2 weeks) reduces motoneuronal calcium in a mouse model of ALS, but its efficacy declines as the disease progresses[1]. | Animal Model: | Female mutant SOD1 Tg mice[1] | | Dosage: | 5 mg/kg | | Administration: | Orally administration; 5 mg/kg; once a day; 2 weeks | | Result: | Had a significant effect in reducing the calcium level only at the age of 12 weeks. |
| | storage | +4°C |
| | Talampanel Preparation Products And Raw materials |
|