|
|
| | 2-(4-Chlorophenoxy)acetonitrile Basic information |
| | 2-(4-Chlorophenoxy)acetonitrile Chemical Properties |
| Melting point | 45-49 °C (lit.) | | Boiling point | 149-150°C 15mm | | density | 1.238±0.06 g/cm3(Predicted) | | Fp | 149-150°C/15mm | | storage temp. | Sealed in dry,Room Temperature | | form | crystalline powder | | color | Beige to light tan | | BRN | 2442163 | | InChI | InChI=1S/C8H6ClNO/c9-7-1-3-8(4-2-7)11-6-5-10/h1-4H,6H2 | | InChIKey | YUGDKEWUYZXXRU-UHFFFAOYSA-N | | SMILES | C(#N)COC1=CC=C(Cl)C=C1 | | CAS DataBase Reference | 3598-13-8(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 36-36/37/39-26 | | RIDADR | 3276 | | WGK Germany | 3 | | Hazard Note | Harmful | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| | 2-(4-Chlorophenoxy)acetonitrile Usage And Synthesis |
| | 2-(4-Chlorophenoxy)acetonitrile Preparation Products And Raw materials |
|