|
|
| | 4-(4-METHYLPHENOXY)BENZALDEHYDE 97 Basic information |
| Product Name: | 4-(4-METHYLPHENOXY)BENZALDEHYDE 97 | | Synonyms: | 4-(4-METHYLPHENOXY)BENZALDEHYDE 97;4-(4-Methylphenoxy)benzaldehyde 97%;JR-8196, 4-(4-Methylphenoxy)benzaldehyde, 97%;Benzaldehyde, 4-(4-methylphenoxy)-;4-(4-methylphenoxy)benzenemethylaldehyde | | CAS: | 61343-83-7 | | MF: | C14H12O2 | | MW: | 212.24 | | EINECS: | | | Product Categories: | | | Mol File: | 61343-83-7.mol |  |
| | 4-(4-METHYLPHENOXY)BENZALDEHYDE 97 Chemical Properties |
| Melting point | 47-51 °C | | Fp | >230 °F | | form | low melting solid | | color | White | | InChI | 1S/C14H12O2/c1-11-2-6-13(7-3-11)16-14-8-4-12(10-15)5-9-14/h2-10H,1H3 | | InChIKey | CKNIKWIWRIHFSJ-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1ccc(Oc2ccc(C)cc2)cc1 |
| Hazard Codes | Xn,N | | Risk Statements | 22-36-43-51/53 | | Safety Statements | 26-36/37-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | HS Code | 2913000090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |
| | 4-(4-METHYLPHENOXY)BENZALDEHYDE 97 Usage And Synthesis |
| Uses | 4-(4-Methylphenoxy)benzaldehyde is used as a reactant in the preparation of a long-term real-time photostable mitotic or proliferating marker, CDy6. |
| | 4-(4-METHYLPHENOXY)BENZALDEHYDE 97 Preparation Products And Raw materials |
|