- Ezetimibe ketone
-
- $35.00
-
2026-05-11
- CAS:191330-56-0
- Purity: 99.32%
- Supply Ability: 10g
- EZM-K
-
- $3.00
-
2020-02-01
- CAS:191330-56-0
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 100KG
|
| Product Name: | EZM-K | | Synonyms: | (3R,4S)-1-(4-Fluorophenyl)-3-[3-(4-fluorophenyl)-3-oxopropyl]-4-(4-hydroxyphenyl)-2-azetidinone;EZM-K;(3R,4S)-1-(4-Fluorophenyl)-3-[3-(4-fluorophenyl)-3-oxopropyl]-4-(4-hydroxyphenyl)azetidin-2-one;Monophenyl phosphite diisooctyl;ETMB-07;EzetiMibe 3-Oxo IMpurity;(3R,4S)-1-(4-Fluorophenyl)-3-(3-(4-fluorophenyl)-3-oxopropyl)-4-(4-hydroxyphenyl)azetidin-2-on;1-(4-Fluorophenyl-3R-[3-(4-Fluorophenyl-3-Oxo-Propyl]-4S-(4-Hydroxyphenyl-AzetidiN-2-One | | CAS: | 191330-56-0 | | MF: | C24H19F2NO3 | | MW: | 407.41 | | EINECS: | | | Product Categories: | Chiral Reagents;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals | | Mol File: | 191330-56-0.mol |  |
| | EZM-K Chemical Properties |
| Melting point | >57°C (dec.) | | Boiling point | 656.1±55.0 °C(Predicted) | | density | 1.325 | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 9.72±0.30(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C24H19F2NO3/c25-17-5-1-15(2-6-17)22(29)14-13-21-23(16-3-11-20(28)12-4-16)27(24(21)30)19-9-7-18(26)8-10-19/h1-12,21,23,28H,13-14H2/t21-,23-/m1/s1 | | InChIKey | UEPZDXMEEKCJSP-FYYLOGMGSA-N | | SMILES | N1(C2=CC=C(F)C=C2)[C@H](C2=CC=C(O)C=C2)[C@@H](CCC(C2=CC=C(F)C=C2)=O)C1=O |
| | EZM-K Usage And Synthesis |
| Chemical Properties | White to Off-White Solid | | Uses | Phase-I metabolite of Ezetimibe (E975000). |
| | EZM-K Preparation Products And Raw materials |
|